The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alismanin H ID: ALA4474400
PubChem CID: 155536938
Max Phase: Preclinical
Molecular Formula: C32H54O5
Molecular Weight: 518.78
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(OC)C(C)(C)[C@@H](O)C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1
Standard InChI: InChI=1S/C32H54O5/c1-19(17-25(35)29(4,5)27(36-9)37-10)20-11-15-31(7)21(20)18-22(33)26-30(6)14-13-24(34)28(2,3)23(30)12-16-32(26,31)8/h19,22-23,25-27,33,35H,11-18H2,1-10H3/t19-,22+,23+,25+,26+,30+,31+,32+/m1/s1
Standard InChI Key: HKNPLLGGSODIDZ-JWZPTIOASA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
38.4145 -15.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0067 -14.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5902 -15.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2951 -13.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2951 -14.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0104 -13.2903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7214 -13.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7179 -14.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4299 -14.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1499 -14.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4369 -13.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1495 -13.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1664 -12.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4422 -12.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8790 -12.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8655 -13.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6457 -13.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1431 -12.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6675 -12.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9350 -11.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3938 -10.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4297 -14.1225 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.7140 -12.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1413 -12.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7099 -15.3583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
40.8611 -14.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5781 -14.9516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.7436 -11.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2843 -11.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0930 -11.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0162 -12.7059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6337 -12.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4423 -12.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.9830 -12.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3656 -13.1701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9063 -13.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8737 -10.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8016 -11.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7324 -12.0515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
5 2 1 0
2 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 14 1 0
12 16 1 0
15 13 1 0
13 14 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 2 0
19 20 1 0
20 21 1 6
11 22 1 1
7 23 1 1
12 24 1 6
8 25 1 6
16 26 1 1
5 27 2 0
20 28 1 0
28 29 1 0
29 30 1 0
29 31 1 1
30 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
35 36 1 0
30 37 1 0
30 38 1 0
14 39 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.78Molecular Weight (Monoisotopic): 518.3971AlogP: 6.31#Rotatable Bonds: 7Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.63CX LogD: 5.63Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 2.74
References 1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC.. (2019) Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism., 182 [PMID:31494470 ] [10.1016/j.ejmech.2019.111652 ]