Alismanin H

ID: ALA4474400

PubChem CID: 155536938

Max Phase: Preclinical

Molecular Formula: C32H54O5

Molecular Weight: 518.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(OC)C(C)(C)[C@@H](O)C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1

Standard InChI:  InChI=1S/C32H54O5/c1-19(17-25(35)29(4,5)27(36-9)37-10)20-11-15-31(7)21(20)18-22(33)26-30(6)14-13-24(34)28(2,3)23(30)12-16-32(26,31)8/h19,22-23,25-27,33,35H,11-18H2,1-10H3/t19-,22+,23+,25+,26+,30+,31+,32+/m1/s1

Standard InChI Key:  HKNPLLGGSODIDZ-JWZPTIOASA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   38.4145  -15.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0067  -14.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5902  -15.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2951  -13.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2951  -14.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0104  -13.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7214  -13.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7179  -14.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4299  -14.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1499  -14.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4369  -13.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1495  -13.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1664  -12.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4422  -12.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8790  -12.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8655  -13.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6457  -13.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1431  -12.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6675  -12.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9350  -11.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3938  -10.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4297  -14.1225    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.7140  -12.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1413  -12.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7099  -15.3583    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.8611  -14.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5781  -14.9516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.7436  -11.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2843  -11.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0930  -11.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0162  -12.7059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.6337  -12.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4423  -12.2337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.9830  -12.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3656  -13.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9063  -13.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8737  -10.9685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8016  -11.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7324  -12.0515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  2  0
 19 20  1  0
 20 21  1  6
 11 22  1  1
  7 23  1  1
 12 24  1  6
  8 25  1  6
 16 26  1  1
  5 27  2  0
 20 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  1
 30 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 30 37  1  0
 30 38  1  0
 14 39  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4474400

    ---

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.78Molecular Weight (Monoisotopic): 518.3971AlogP: 6.31#Rotatable Bonds: 7
Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.63CX LogD: 5.63
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 2.74

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source