The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-((1-(3,4-dimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl)methyl)-1H-1,2,3-triazol-4-yl)methyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA4474410
PubChem CID: 155536994
Max Phase: Preclinical
Molecular Formula: C35H26N6O4
Molecular Weight: 594.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc(Cn3cc(CN4C(=O)c5cccc6cccc(c56)C4=O)nn3)cc3c2[nH]c2ccccc23)cc1OC
Standard InChI: InChI=1S/C35H26N6O4/c1-44-29-14-13-21(15-30(29)45-2)32-33-27(24-9-3-4-12-28(24)37-33)16-22(36-32)17-40-18-23(38-39-40)19-41-34(42)25-10-5-7-20-8-6-11-26(31(20)25)35(41)43/h3-16,18,37H,17,19H2,1-2H3
Standard InChI Key: DXSNVHDBEAQUCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 52 0 0 0 0 0 0 0 0999 V2000
25.8942 -6.7893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2330 -6.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4870 -5.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3056 -5.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5555 -6.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3617 -6.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9031 -5.8689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6485 -5.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8510 -4.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2279 -4.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0191 -4.7258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6551 -4.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3426 -4.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1308 -5.4465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3142 -5.4911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1297 -4.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7091 -5.0232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5003 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0796 -5.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8677 -6.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0765 -6.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4972 -5.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7100 -6.0264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8636 -7.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4475 -7.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2324 -7.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4440 -6.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2395 -6.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4474 -5.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8676 -5.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7122 -4.0242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5736 -7.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3607 -7.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5748 -8.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9952 -8.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2089 -8.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9907 -7.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2071 -9.6405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9942 -9.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3619 -8.4815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9412 -7.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9362 -4.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1371 -5.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8874 -5.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4351 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
4 9 1 0
8 10 1 0
10 11 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
16 17 1 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 2 0
22 21 1 0
17 22 1 0
22 23 2 0
21 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
20 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
19 30 2 0
18 31 2 0
32 6 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
35 38 1 0
38 39 1 0
34 40 1 0
40 41 1 0
3 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
2 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.63Molecular Weight (Monoisotopic): 594.2016AlogP: 5.99#Rotatable Bonds: 7Polar Surface Area: 115.23Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.32CX Basic pKa: 4.01CX LogP: 5.18CX LogD: 5.18Aromatic Rings: 7Heavy Atoms: 45QED Weighted: 0.23Np Likeness Score: -0.73
References 1. Klein-Júnior LC, Corrêa R, Vander Heyden Y, Cechinel Filho V.. (2019) All that glitters is not gold: Panning cytotoxic natural products and derivatives with a fused tricyclic backbone by the estimation of their leadlikeness for cancer treatment., 166 [PMID:30684866 ] [10.1016/j.ejmech.2019.01.028 ] 2. Xu Z, Zhao SJ, Liu Y.. (2019) 1,2,3-Triazole-containing hybrids as potential anticancer agents: Current developments, action mechanisms and structure-activity relationships., 183 [PMID:31546197 ] [10.1016/j.ejmech.2019.111700 ] 3. Luo B, Song X.. (2021) A comprehensive overview of β-carbolines and its derivatives as anticancer agents., 224 [PMID:34332400 ] [10.1016/j.ejmech.2021.113688 ]