The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(3-(3-chloro-5-hydroxyphenyl)-4-(pyridin-4-yl)-1H-pyrazol-1-yl)phenyl)-3-(trifluoromethyl)benzamide ID: ALA4474427
PubChem CID: 155536944
Max Phase: Preclinical
Molecular Formula: C28H18ClF3N4O2
Molecular Weight: 534.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(-n2cc(-c3ccncc3)c(-c3cc(O)cc(Cl)c3)n2)c1)c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C28H18ClF3N4O2/c29-21-12-19(13-24(37)14-21)26-25(17-7-9-33-10-8-17)16-36(35-26)23-6-2-5-22(15-23)34-27(38)18-3-1-4-20(11-18)28(30,31)32/h1-16,37H,(H,34,38)
Standard InChI Key: OJHWSNCMRXXDGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
6.4659 -9.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4648 -10.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1728 -10.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8825 -10.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8797 -9.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1711 -8.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5909 -10.4798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7569 -10.4805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9892 -10.2116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4961 -10.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9635 -11.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7454 -11.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6791 -10.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2899 -10.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4736 -10.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0505 -10.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4495 -11.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2645 -11.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5619 -12.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7476 -12.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3466 -12.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7626 -13.6685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5840 -13.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9813 -12.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0297 -12.2338 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0793 -9.3989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2979 -10.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2966 -9.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0063 -10.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0029 -11.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7104 -11.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4185 -11.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4146 -10.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7065 -10.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1202 -10.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8300 -10.4622 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.1160 -9.2400 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8233 -9.6412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
2 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
15 26 1 0
7 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
33 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.93Molecular Weight (Monoisotopic): 534.1070AlogP: 7.23#Rotatable Bonds: 5Polar Surface Area: 80.04Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.34CX Basic pKa: 4.25CX LogP: 6.79CX LogD: 6.74Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.58
References 1. Tarazi H, El-Gamal MI, Oh CH.. (2019) Discovery of highly potent V600E-B-RAF kinase inhibitors: Molecular modeling study., 27 (4): [PMID:30660499 ] [10.1016/j.bmc.2019.01.004 ]