The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-7-(2-methoxy-5-(2-methyl-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-en-1-yl)phenoxy)heptanamide ID: ALA4474450
PubChem CID: 148304223
Max Phase: Preclinical
Molecular Formula: C27H35NO8
Molecular Weight: 501.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(\C)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCCCCCCC(=O)NO
Standard InChI: InChI=1S/C27H35NO8/c1-18(26(30)20-16-23(33-3)27(35-5)24(17-20)34-4)14-19-11-12-21(32-2)22(15-19)36-13-9-7-6-8-10-25(29)28-31/h11-12,14-17,31H,6-10,13H2,1-5H3,(H,28,29)/b18-14+
Standard InChI Key: KZTUUPMJFDJJBY-NBVRZTHBSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
14.9629 -20.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6676 -20.1312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9689 -21.3621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3783 -20.5346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6471 -20.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6459 -21.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3540 -21.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0636 -21.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0608 -20.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3522 -20.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3538 -22.6570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0614 -23.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9379 -21.8389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2305 -21.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9392 -20.2029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2316 -20.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7669 -20.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4762 -20.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7639 -19.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1824 -20.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8916 -20.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8916 -21.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6000 -21.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3071 -21.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3014 -20.5863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5924 -20.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0169 -21.8127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7225 -21.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0061 -20.1725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7168 -20.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4215 -20.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1322 -20.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8369 -20.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5475 -20.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2523 -20.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4793 -21.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
7 11 1 0
11 12 1 0
6 13 1 0
13 14 1 0
5 15 1 0
15 16 1 0
9 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
25 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 1 1 0
18 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.58Molecular Weight (Monoisotopic): 501.2363AlogP: 4.84#Rotatable Bonds: 15Polar Surface Area: 112.55Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 4.02CX LogD: 4.01Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: 0.10
References 1. Wang B, Chen X, Gao J, Su L, Zhang L, Xu H, Luan Y.. (2019) Anti-tumor activity evaluation of novel tubulin and HDAC dual-targeting inhibitors., 29 (18): [PMID:31400938 ] [10.1016/j.bmcl.2019.07.045 ]