The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Terrelumamide A ID: ALA4474465
PubChem CID: 139587886
Max Phase: Preclinical
Molecular Formula: C20H20N6O7
Molecular Weight: 456.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccccc1NC(=O)[C@@H](NC(=O)c1cnc2c(n1)c(=O)[nH]c(=O)n2C)[C@@H](C)O
Standard InChI: InChI=1S/C20H20N6O7/c1-9(27)13(17(29)23-11-7-5-4-6-10(11)19(31)33-3)24-16(28)12-8-21-15-14(22-12)18(30)25-20(32)26(15)2/h4-9,13,27H,1-3H3,(H,23,29)(H,24,28)(H,25,30,32)/t9-,13+/m1/s1
Standard InChI Key: YVUJATOOBNWJDN-RNCFNFMXSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
5.4397 -17.0124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4397 -17.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1450 -18.2341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1450 -16.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8502 -17.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8486 -17.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5529 -18.2351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2592 -17.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2568 -17.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5520 -16.6060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7326 -18.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1450 -15.7825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9632 -16.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6722 -17.0051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9606 -15.7816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3786 -16.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0876 -17.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3760 -15.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0824 -15.3662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6670 -15.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0902 -17.8178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7940 -16.5897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5030 -16.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5012 -17.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2094 -18.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9168 -17.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9115 -16.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2028 -16.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1971 -15.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9019 -15.3549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4865 -15.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6125 -15.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1462 -19.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 2 0
4 12 2 0
9 13 1 0
13 14 1 0
13 15 2 0
16 14 1 1
16 17 1 0
16 18 1 0
18 19 1 1
18 20 1 0
17 21 2 0
17 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
3 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.42Molecular Weight (Monoisotopic): 456.1393AlogP: -1.08#Rotatable Bonds: 6Polar Surface Area: 185.37Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.62CX Basic pKa: ┄CX LogP: 0.12CX LogD: 0.10Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.00