(S)-6-amino-N-(4-benzoylphenyl)-2-(4-methylphenylsulfonamido)hexanamide

ID: ALA4474476

PubChem CID: 155537066

Max Phase: Preclinical

Molecular Formula: C26H29N3O4S

Molecular Weight: 479.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(=O)Nc2ccc(C(=O)c3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C26H29N3O4S/c1-19-10-16-23(17-11-19)34(32,33)29-24(9-5-6-18-27)26(31)28-22-14-12-21(13-15-22)25(30)20-7-3-2-4-8-20/h2-4,7-8,10-17,24,29H,5-6,9,18,27H2,1H3,(H,28,31)/t24-/m0/s1

Standard InChI Key:  KZQBMVFWWVELDK-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    8.1760   -6.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3588   -6.9379    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674   -7.6456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3591   -6.1227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0691   -5.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -6.9419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -6.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0691   -4.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -4.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -3.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4892   -3.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4892   -2.4340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4892   -5.7110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1977   -6.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1971   -6.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9048   -7.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6127   -6.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6085   -6.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9004   -5.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3217   -7.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3243   -8.1556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0281   -6.9276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7336   -7.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4395   -6.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4373   -6.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7234   -5.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0204   -6.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6536   -7.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9479   -6.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2432   -7.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2468   -8.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9611   -8.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6629   -8.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5417   -8.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  7 13  1  0
  4  5  1  0
  5  7  1  0
  7  6  2  0
  5  8  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  4  2  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474476

    ---

Associated Targets(Human)

PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.60Molecular Weight (Monoisotopic): 479.1879AlogP: 3.64#Rotatable Bonds: 11
Polar Surface Area: 118.36Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.59CX Basic pKa: 9.98CX LogP: 3.61CX LogD: 1.54
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.90

References

1. Steinmetzer T, Pilgram O, Wenzel BM, Wiedemeyer SJA..  (2020)  Fibrinolysis Inhibitors: Potential Drugs for the Treatment and Prevention of Bleeding.,  63  (4): [PMID:31658420] [10.1021/acs.jmedchem.9b01060]

Source