The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,6,7-Trimethoxy-3(R)-(3'hydroxy-4'-methoxybenzyl)-4-chromanone ID: ALA4474477
PubChem CID: 155537067
Max Phase: Preclinical
Molecular Formula: C20H22O7
Molecular Weight: 374.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C[C@@H]2COc3cc(OC)c(OC)c(OC)c3C2=O)cc1O
Standard InChI: InChI=1S/C20H22O7/c1-23-14-6-5-11(8-13(14)21)7-12-10-27-15-9-16(24-2)19(25-3)20(26-4)17(15)18(12)22/h5-6,8-9,12,21H,7,10H2,1-4H3/t12-/m1/s1
Standard InChI Key: QPXDJAQCABFFAR-GFCCVEGCSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
5.7211 -29.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8610 -28.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8598 -29.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5747 -29.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5729 -27.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 -28.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2871 -29.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0001 -29.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7199 -28.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0024 -27.8013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9978 -30.2833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1465 -27.8082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5764 -30.2857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4341 -29.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1500 -29.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8614 -29.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5769 -29.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5802 -28.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8621 -27.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1497 -28.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2956 -27.8264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1451 -29.4598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4309 -29.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2897 -29.4785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1463 -26.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8628 -30.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2974 -27.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 10 1 0
7 8 1 0
1 8 1 0
1 9 1 0
9 10 1 0
8 11 2 0
2 12 1 0
4 13 1 0
1 14 1 1
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
3 22 1 0
22 23 1 0
17 24 1 0
12 25 1 0
13 26 1 0
21 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.39Molecular Weight (Monoisotopic): 374.1366AlogP: 2.86#Rotatable Bonds: 6Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.90CX Basic pKa: ┄CX LogP: 2.50CX LogD: 2.50Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.83Np Likeness Score: 1.38
References 1. Schwikkard S, Whitmore H, Sishtla K, Sulaiman RS, Shetty T, Basavarajappa HD, Waller C, Alqahtani A, Frankemoelle L, Chapman A, Crouch N, Wetschnig W, Knirsch W, Andriantiana J, Mas-Claret E, Langat MK, Mulholland D, Corson TW.. (2019) The Antiangiogenic Activity of Naturally Occurring and Synthetic Homoisoflavonoids from the Hyacinthaceae ( sensu APGII)., 82 (5): [PMID:30951308 ] [10.1021/acs.jnatprod.8b00989 ]