The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((2S,3R)-3-Hydroxy-1-oxo-1-(dodecylamino)butan-2-yl)benzamide ID: ALA4474489
PubChem CID: 74223373
Max Phase: Preclinical
Molecular Formula: C23H38N2O3
Molecular Weight: 390.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCNC(=O)[C@@H](NC(=O)c1ccccc1)[C@@H](C)O
Standard InChI: InChI=1S/C23H38N2O3/c1-3-4-5-6-7-8-9-10-11-15-18-24-23(28)21(19(2)26)25-22(27)20-16-13-12-14-17-20/h12-14,16-17,19,21,26H,3-11,15,18H2,1-2H3,(H,24,28)(H,25,27)/t19-,21+/m1/s1
Standard InChI Key: ANRUPLIPTPNTBN-CTNGQTDRSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
13.6653 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4866 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2525 -2.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2525 -3.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8993 -3.7866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8952 -2.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7206 -2.3629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4866 -1.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4920 -4.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9019 -5.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6748 -4.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4903 -5.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8995 -6.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7176 -6.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1247 -5.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7131 -5.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1292 -3.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9464 -3.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3550 -3.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1722 -3.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5808 -3.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3980 -3.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8066 -2.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6238 -2.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0324 -3.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6238 -3.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0324 -4.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6238 -5.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 1
1 4 1 0
2 5 1 1
2 6 1 0
6 7 1 0
6 8 2 0
5 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
7 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.57Molecular Weight (Monoisotopic): 390.2882AlogP: 4.20#Rotatable Bonds: 15Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.76CX LogD: 4.76Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: -0.31
References 1. Liu Q, Li X, Bao YS, Lu J, Li H, Huang Z, Liu F.. (2019) Chemical synthesis and functional characterization of a new class of ceramide analogues as anti-cancer agents., 27 (8): [PMID:30837168 ] [10.1016/j.bmc.2019.02.030 ]