(R)-Ganocapenoid A

ID: ALA4474490

PubChem CID: 155537209

Max Phase: Preclinical

Molecular Formula: C21H26O6

Molecular Weight: 374.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C(=C\CCC1=C[C@H](c2cc(O)ccc2O)OC1=O)CCC=C(CO)CO

Standard InChI:  InChI=1S/C21H26O6/c1-14(4-2-6-15(12-22)13-23)5-3-7-16-10-20(27-21(16)26)18-11-17(24)8-9-19(18)25/h5-6,8-11,20,22-25H,2-4,7,12-13H2,1H3/b14-5+/t20-/m1/s1

Standard InChI Key:  ARTPIECVCQOZJT-YOBGLANUSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
    5.8897   -5.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6441   -5.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1939   -4.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7787   -4.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9724   -4.1826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9084   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6229   -4.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1114   -3.2529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3373   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0518   -4.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7663   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0518   -3.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4807   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1952   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9097   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6241   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9097   -3.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6241   -3.4834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3387   -4.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1767   -5.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7495   -5.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7483   -6.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4632   -6.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1796   -6.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4614   -5.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4630   -7.4899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4588   -4.1870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  6  3  1  0
  4  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 10 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 16 19  1  0
  1 20  1  6
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
 20 25  2  0
 25 21  1  0
 23 26  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474490

    ---

Associated Targets(non-human)

PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.43Molecular Weight (Monoisotopic): 374.1729AlogP: 3.04#Rotatable Bonds: 9
Polar Surface Area: 107.22Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.32CX Basic pKa: CX LogP: 2.87CX LogD: 2.86
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.30Np Likeness Score: 2.83

References

1. Liao GF, Wu ZH, Liu Y, Yan YM, Lu RM, Cheng YX..  (2019)  Ganocapenoids A-D: Four new aromatic meroterpenoids from Ganoderma capense.,  29  (2): [PMID:30527867] [10.1016/j.bmcl.2018.12.011]

Source