The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-Ganocapenoid A ID: ALA4474490
PubChem CID: 155537209
Max Phase: Preclinical
Molecular Formula: C21H26O6
Molecular Weight: 374.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\CCC1=C[C@H](c2cc(O)ccc2O)OC1=O)CCC=C(CO)CO
Standard InChI: InChI=1S/C21H26O6/c1-14(4-2-6-15(12-22)13-23)5-3-7-16-10-20(27-21(16)26)18-11-17(24)8-9-19(18)25/h5-6,8-11,20,22-25H,2-4,7,12-13H2,1H3/b14-5+/t20-/m1/s1
Standard InChI Key: ARTPIECVCQOZJT-YOBGLANUSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
5.8897 -5.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6441 -5.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1939 -4.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7787 -4.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9724 -4.1826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9084 -5.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6229 -4.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1114 -3.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3373 -5.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0518 -4.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7663 -5.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0518 -3.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4807 -4.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1952 -5.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9097 -4.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6241 -5.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9097 -3.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6241 -3.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3387 -4.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1767 -5.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7495 -5.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7483 -6.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4632 -6.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1796 -6.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4614 -5.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4630 -7.4899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4588 -4.1870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 0
6 3 1 0
4 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
10 12 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
15 17 1 0
17 18 1 0
16 19 1 0
1 20 1 6
21 22 2 0
22 23 1 0
23 24 2 0
24 20 1 0
20 25 2 0
25 21 1 0
23 26 1 0
25 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.43Molecular Weight (Monoisotopic): 374.1729AlogP: 3.04#Rotatable Bonds: 9Polar Surface Area: 107.22Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.32CX Basic pKa: ┄CX LogP: 2.87CX LogD: 2.86Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.30Np Likeness Score: 2.83
References 1. Liao GF, Wu ZH, Liu Y, Yan YM, Lu RM, Cheng YX.. (2019) Ganocapenoids A-D: Four new aromatic meroterpenoids from Ganoderma capense., 29 (2): [PMID:30527867 ] [10.1016/j.bmcl.2018.12.011 ]