The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(4-Benzyloxy-phenyl)-2-(2-{1-[3-(3,4,5-trimethoxy-phenyl)-propionyl]-piperidin-4-yl}-acetylamino)-propionic acid methyl ester ID: ALA4474491
PubChem CID: 134355744
Max Phase: Preclinical
Molecular Formula: C36H44N2O8
Molecular Weight: 632.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)CCc2cc(OC)c(OC)c(OC)c2)CC1
Standard InChI: InChI=1S/C36H44N2O8/c1-42-31-21-28(22-32(43-2)35(31)44-3)12-15-34(40)38-18-16-26(17-19-38)23-33(39)37-30(36(41)45-4)20-25-10-13-29(14-11-25)46-24-27-8-6-5-7-9-27/h5-11,13-14,21-22,26,30H,12,15-20,23-24H2,1-4H3,(H,37,39)/t30-/m0/s1
Standard InChI Key: WXMLFQPBXOQZCQ-PMERELPUSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
8.9044 -16.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6177 -15.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3308 -16.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3308 -16.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6177 -17.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9044 -16.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0437 -17.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7607 -16.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4736 -17.3382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1866 -16.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9035 -17.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6165 -16.9235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3293 -17.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9035 -18.1632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1866 -16.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9035 -15.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8998 -14.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6143 -14.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3274 -14.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3297 -15.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6167 -16.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0404 -14.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0404 -13.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7575 -13.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7578 -12.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4681 -11.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1814 -12.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1836 -13.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4746 -13.6287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7607 -16.0985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1873 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4745 -16.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7616 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0445 -16.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0442 -16.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3338 -17.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6206 -16.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6184 -16.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3272 -15.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9013 -15.6907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1885 -16.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 -17.3350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 -18.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3338 -18.1602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0467 -18.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1873 -14.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 2 0
10 15 1 1
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
8 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
35 34 2 0
36 35 1 0
37 36 2 0
38 37 1 0
39 38 2 0
34 39 1 0
38 40 1 0
40 41 1 0
37 42 1 0
42 43 1 0
36 44 1 0
44 45 1 0
31 46 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.75Molecular Weight (Monoisotopic): 632.3098AlogP: 4.75#Rotatable Bonds: 15Polar Surface Area: 112.63Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.24CX Basic pKa: ┄CX LogP: 4.32CX LogD: 4.32Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.24Np Likeness Score: -0.44
References 1. (2018) Yap1 inhibitors that target the interaction of yap1 with oct4,