The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((4-morpholinophenyl)amino)pyrimidin-4-yl)-N-(4-(trifluoromethyl)phenyl)piperazine-1-carboxamide ID: ALA4474522
PubChem CID: 155537141
Max Phase: Preclinical
Molecular Formula: C26H28F3N7O2
Molecular Weight: 527.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(F)(F)F)cc1)N1CCN(c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)CC1
Standard InChI: InChI=1S/C26H28F3N7O2/c27-26(28,29)19-1-3-21(4-2-19)32-25(37)36-13-11-35(12-14-36)23-9-10-30-24(33-23)31-20-5-7-22(8-6-20)34-15-17-38-18-16-34/h1-10H,11-18H2,(H,32,37)(H,30,31,33)
Standard InChI Key: BOUSFRWZRKLHPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
21.2373 -18.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2362 -18.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9483 -19.2768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6621 -18.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6593 -18.0406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9465 -17.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3746 -19.2749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3759 -20.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6634 -20.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6643 -21.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3773 -21.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0867 -21.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0823 -20.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3812 -22.5539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6687 -22.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6691 -23.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3803 -24.1956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0887 -23.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0899 -22.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9464 -16.8133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6589 -16.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6584 -15.5861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9471 -15.1716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2347 -15.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2335 -16.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9478 -14.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6600 -13.9423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2363 -13.9411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3715 -14.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3691 -15.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0756 -15.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7888 -15.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7868 -14.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0755 -13.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5008 -15.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5013 -16.4115 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.2124 -15.1771 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.2079 -15.9971 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
11 14 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
6 20 1 0
23 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.55Molecular Weight (Monoisotopic): 527.2257AlogP: 4.43#Rotatable Bonds: 5Polar Surface Area: 85.86Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.35CX Basic pKa: 5.70CX LogP: 4.62CX LogD: 4.61Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: -1.97
References 1. Li Y, Ye T, Xu L, Dong Y, Luo Y, Wang C, Han Y, Chen K, Qin M, Liu Y, Zhao Y.. (2019) Discovery of 4-piperazinyl-2-aminopyrimidine derivatives as dual inhibitors of JAK2 and FLT3., 181 [PMID:31408808 ] [10.1016/j.ejmech.2019.111590 ]