1-(4-((5-chloro-4-((1-methyl-1H-indol-5-yl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea

ID: ALA4474553

PubChem CID: 155537240

Max Phase: Preclinical

Molecular Formula: C27H25ClN8O2

Molecular Weight: 529.00

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)NCc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2ccc3c(ccn3C)c2)n1

Standard InChI:  InChI=1S/C27H25ClN8O2/c1-36-11-9-18-12-19(6-8-23(18)36)32-25-21(28)16-30-26(35-25)34-22-7-5-20(13-24(22)38-2)33-27(37)31-15-17-4-3-10-29-14-17/h3-14,16H,15H2,1-2H3,(H2,31,33,37)(H2,30,32,34,35)

Standard InChI Key:  RSLBDZCWHUTAFY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    0.4938  -18.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4927  -19.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2007  -19.7019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9104  -19.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9076  -18.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1990  -18.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6137  -18.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3230  -18.4645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0292  -18.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7384  -18.4592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4446  -18.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1498  -18.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8555  -18.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8529  -17.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1386  -16.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4359  -17.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0261  -17.2361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5645  -18.4513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5672  -19.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5585  -16.8147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2683  -17.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2683  -18.0371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9772  -18.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6838  -18.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6770  -17.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9675  -16.8071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3941  -18.4338    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.3811  -16.7936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0923  -17.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0942  -18.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8045  -18.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7890  -16.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4999  -17.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5109  -17.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2953  -18.2433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7693  -17.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2777  -16.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5581  -19.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  2  0
 13 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 34  2  0
 33 32  2  0
 32 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 33  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474553

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.00Molecular Weight (Monoisotopic): 528.1789AlogP: 5.83#Rotatable Bonds: 8
Polar Surface Area: 118.02Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.75CX Basic pKa: 4.82CX LogP: 4.61CX LogD: 4.61
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -1.81

References

1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y..  (2019)  Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors.,  178  [PMID:31177074] [10.1016/j.ejmech.2019.05.060]

Source