The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((1-methyl-1H-indol-5-yl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea ID: ALA4474553
PubChem CID: 155537240
Max Phase: Preclinical
Molecular Formula: C27H25ClN8O2
Molecular Weight: 529.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)NCc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2ccc3c(ccn3C)c2)n1
Standard InChI: InChI=1S/C27H25ClN8O2/c1-36-11-9-18-12-19(6-8-23(18)36)32-25-21(28)16-30-26(35-25)34-22-7-5-20(13-24(22)38-2)33-27(37)31-15-17-4-3-10-29-14-17/h3-14,16H,15H2,1-2H3,(H2,31,33,37)(H2,30,32,34,35)
Standard InChI Key: RSLBDZCWHUTAFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.4938 -18.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4927 -19.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2007 -19.7019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9104 -19.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9076 -18.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1990 -18.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6137 -18.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3230 -18.4645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -18.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7384 -18.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4446 -18.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1498 -18.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8555 -18.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8529 -17.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1386 -16.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4359 -17.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0261 -17.2361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5645 -18.4513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5672 -19.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5585 -16.8147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2683 -17.2197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2683 -18.0371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9772 -18.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6838 -18.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6770 -17.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9675 -16.8071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3941 -18.4338 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.3811 -16.7936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0923 -17.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0942 -18.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8045 -18.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7890 -16.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4999 -17.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5109 -17.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2953 -18.2433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7693 -17.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2777 -16.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5581 -19.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 2 0
13 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 34 2 0
33 32 2 0
32 29 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 33 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.00Molecular Weight (Monoisotopic): 528.1789AlogP: 5.83#Rotatable Bonds: 8Polar Surface Area: 118.02Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.75CX Basic pKa: 4.82CX LogP: 4.61CX LogD: 4.61Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -1.81
References 1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y.. (2019) Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors., 178 [PMID:31177074 ] [10.1016/j.ejmech.2019.05.060 ]