The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
13-desmethylene-17-desmethyl dactylolide ID: ALA4474575
PubChem CID: 155537126
Max Phase: Preclinical
Molecular Formula: C21H26O5
Molecular Weight: 358.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C1=C/C=C/C(=O)O[C@H](C=O)C/C=C/[C@@H]2CCC[C@H](C/C=C/C(=O)C1)O2
Standard InChI: InChI=1S/C21H26O5/c1-16-6-2-13-21(24)26-20(15-22)12-5-11-19-10-4-9-18(25-19)8-3-7-17(23)14-16/h2-3,5-7,11,13,15,18-20H,4,8-10,12,14H2,1H3/b7-3+,11-5+,13-2+,16-6-/t18-,19-,20-/m0/s1
Standard InChI Key: FWXBAKUCYNFJLA-YIOXLTTFSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
5.8257 -18.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5419 -18.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2582 -18.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2582 -17.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5419 -16.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9742 -16.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9774 -16.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6935 -15.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6966 -14.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4127 -14.5185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9837 -14.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9868 -13.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2740 -13.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5578 -13.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8450 -13.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1289 -13.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4160 -13.2619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1257 -14.5022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4096 -14.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4065 -15.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1194 -16.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1162 -16.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8291 -17.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6967 -14.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6999 -13.6717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7029 -13.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2503 -16.5715 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.8210 -16.5674 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
23 5 1 0
4 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
19 24 1 1
24 25 2 0
12 26 1 0
4 27 1 6
23 28 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 358.43Molecular Weight (Monoisotopic): 358.1780AlogP: 3.40#Rotatable Bonds: 1Polar Surface Area: 69.67Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.46CX LogD: 3.46Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.41Np Likeness Score: 2.73
References 1. Henry JL, Wilson MR, Mulligan MP, Quinn TR, Sackett DL, Taylor RE.. (2019) Synthesis, conformational preferences, and biological activity of conformational analogues of the microtubule-stabilizing agents, (-)-zampanolide and (-)-dactylolide., 10 (5): [PMID:31191870 ] [10.1039/C9MD00164F ]