(S)-1-(2-Benzyl-3-oxoisoindoline-4-carbonyl)-4,4-difluoropyrrolidine-2-carbonitrile

ID: ALA4474579

PubChem CID: 155537130

Max Phase: Preclinical

Molecular Formula: C21H17F2N3O2

Molecular Weight: 381.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C[C@@H]1CC(F)(F)CN1C(=O)c1cccc2c1C(=O)N(Cc1ccccc1)C2

Standard InChI:  InChI=1S/C21H17F2N3O2/c22-21(23)9-16(10-24)26(13-21)19(27)17-8-4-7-15-12-25(20(28)18(15)17)11-14-5-2-1-3-6-14/h1-8,16H,9,11-13H2/t16-/m0/s1

Standard InChI Key:  SVZJKAXGIPHYOI-INIZCTEOSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   32.0768  -15.2501    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.3711  -15.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0814  -16.0677    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.3691  -14.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0787  -13.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0759  -12.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3673  -12.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6610  -13.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6623  -12.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8861  -12.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4051  -13.3482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8841  -14.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3689  -14.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6611  -15.3929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0765  -15.3933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1647  -16.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9640  -16.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8260  -15.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6304  -14.7863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5879  -13.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1803  -12.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5934  -11.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1865  -11.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3685  -11.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9590  -11.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3682  -12.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5530  -16.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9466  -17.2992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  4 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17  2  1  0
  2 18  1  0
 18 15  1  0
 12 19  2  0
 11 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  3  0
 16 27  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4474579

    ---

Associated Targets(Human)

PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FAP Tchem Fibroblast activation protein alpha (827 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.38Molecular Weight (Monoisotopic): 381.1289AlogP: 3.22#Rotatable Bonds: 3
Polar Surface Area: 64.41Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 13.53CX Basic pKa: CX LogP: 2.59CX LogD: 2.59
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: -0.70

References

1. Plescia J, De Cesco S, Patrascu MB, Kurian J, Di Trani J, Dufresne C, Wahba AS, Janmamode N, Mittermaier AK, Moitessier N..  (2019)  Integrated Synthetic, Biophysical, and Computational Investigations of Covalent Inhibitors of Prolyl Oligopeptidase and Fibroblast Activation Protein α.,  62  (17): [PMID:31393718] [10.1021/acs.jmedchem.9b00642]

Source