(3-(3-Chlorophenyl)-4-methoxybenzyl)phenylalanine

ID: ALA4474581

PubChem CID: 155537132

Max Phase: Preclinical

Molecular Formula: C23H22ClNO3

Molecular Weight: 395.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CN[C@@H](Cc2ccccc2)C(=O)O)cc1-c1cccc(Cl)c1

Standard InChI:  InChI=1S/C23H22ClNO3/c1-28-22-11-10-17(12-20(22)18-8-5-9-19(24)14-18)15-25-21(23(26)27)13-16-6-3-2-4-7-16/h2-12,14,21,25H,13,15H2,1H3,(H,26,27)/t21-/m0/s1

Standard InChI Key:  CBDSPCUCGKLXJH-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   25.5131  -10.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5120  -11.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2200  -11.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9297  -11.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9268  -10.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2182  -10.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8058  -11.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0982  -11.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3906  -11.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3895  -12.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1019  -12.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8065  -12.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6380  -11.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8053  -10.0871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8051   -9.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1041  -13.7641    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.3451  -11.3123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0534  -11.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7605  -11.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4689  -11.7176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7592  -10.4929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0547  -12.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7631  -12.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7600  -13.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4675  -14.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1755  -13.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1716  -12.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4635  -12.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  2  7  1  0
  4 13  1  0
  1 14  1  0
 14 15  1  0
 11 16  1  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 18 22  1  6
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474581

    ---

Associated Targets(Human)

PDE4B Tclin Phosphodiesterase 4B (2748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.89Molecular Weight (Monoisotopic): 395.1288AlogP: 4.80#Rotatable Bonds: 8
Polar Surface Area: 58.56Molecular Species: ZWITTERIONHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 1.68CX Basic pKa: 9.69CX LogP: 2.86CX LogD: 2.86
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: -0.53

References

1. Tang L, Huang C, Zhong J, He J, Guo J, Liu M, Xu JP, Wang HT, Zhou ZZ..  (2019)  Discovery of arylbenzylamines as PDE4 inhibitors with potential neuroprotective effect.,  168  [PMID:30822711] [10.1016/j.ejmech.2019.02.026]

Source