The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-(3-Chlorophenyl)-4-methoxybenzyl)phenylalanine ID: ALA4474581
PubChem CID: 155537132
Max Phase: Preclinical
Molecular Formula: C23H22ClNO3
Molecular Weight: 395.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN[C@@H](Cc2ccccc2)C(=O)O)cc1-c1cccc(Cl)c1
Standard InChI: InChI=1S/C23H22ClNO3/c1-28-22-11-10-17(12-20(22)18-8-5-9-19(24)14-18)15-25-21(23(26)27)13-16-6-3-2-4-7-16/h2-12,14,21,25H,13,15H2,1H3,(H,26,27)/t21-/m0/s1
Standard InChI Key: CBDSPCUCGKLXJH-NRFANRHFSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
25.5131 -10.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5120 -11.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2200 -11.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9297 -11.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9268 -10.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2182 -10.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8058 -11.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0982 -11.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3906 -11.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3895 -12.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1019 -12.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8065 -12.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6380 -11.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8053 -10.0871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8051 -9.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1041 -13.7641 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.3451 -11.3123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0534 -11.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7605 -11.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4689 -11.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7592 -10.4929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0547 -12.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7631 -12.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7600 -13.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4675 -14.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1755 -13.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1716 -12.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4635 -12.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
2 7 1 0
4 13 1 0
1 14 1 0
14 15 1 0
11 16 1 0
13 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
18 22 1 6
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.89Molecular Weight (Monoisotopic): 395.1288AlogP: 4.80#Rotatable Bonds: 8Polar Surface Area: 58.56Molecular Species: ZWITTERIONHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.68CX Basic pKa: 9.69CX LogP: 2.86CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: -0.53
References 1. Tang L, Huang C, Zhong J, He J, Guo J, Liu M, Xu JP, Wang HT, Zhou ZZ.. (2019) Discovery of arylbenzylamines as PDE4 inhibitors with potential neuroprotective effect., 168 [PMID:30822711 ] [10.1016/j.ejmech.2019.02.026 ]