The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl-3-((3-fluoro-4-((5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)phenyl)carbamoyl)-1,2-dimethyl-4-oxo-1,4-dihydroquinoline-6-carboxylate ID: ALA4474599
PubChem CID: 126617672
Max Phase: Preclinical
Molecular Formula: C32H24FN5O5
Molecular Weight: 577.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2c(c1)c(=O)c(C(=O)Nc1ccc(Oc3ncnc4[nH]cc(-c5ccccc5)c34)c(F)c1)c(C)n2C
Standard InChI: InChI=1S/C32H24FN5O5/c1-17-26(28(39)21-13-19(32(41)42-3)9-11-24(21)38(17)2)30(40)37-20-10-12-25(23(33)14-20)43-31-27-22(18-7-5-4-6-8-18)15-34-29(27)35-16-36-31/h4-16H,1-3H3,(H,37,40)(H,34,35,36)
Standard InChI Key: FQAAJFWBYKMHIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
25.3133 -2.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0304 -2.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0274 -1.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3114 -1.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5979 -2.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6019 -1.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8947 -1.2720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1788 -1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1747 -2.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8864 -2.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4572 -2.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8835 -3.7449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7445 -2.4929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4522 -3.7358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0270 -2.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3179 -2.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6008 -2.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5953 -3.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3131 -4.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0271 -3.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8783 -4.1265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8745 -4.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8665 -6.6008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5860 -6.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5867 -5.3634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1529 -6.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1570 -5.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3778 -5.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8919 -5.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3711 -6.4335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1251 -4.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6824 -3.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4318 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6243 -2.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0677 -3.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3214 -4.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9000 -0.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4664 -1.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8885 -2.4729 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.7461 -2.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7474 -3.7457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4605 -2.5060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1762 -2.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
10 12 2 0
11 13 1 0
11 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 27 2 0
26 23 2 0
23 24 1 0
24 25 2 0
25 22 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 31 1 0
7 37 1 0
8 38 1 0
17 39 1 0
2 40 1 0
40 41 2 0
40 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.57Molecular Weight (Monoisotopic): 577.1761AlogP: 5.76#Rotatable Bonds: 6Polar Surface Area: 128.20Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: 3.43CX LogP: 5.44CX LogD: 5.44Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.24Np Likeness Score: -1.12
References 1. Tan L, Zhang Z, Gao D, Luo J, Tu ZC, Li Z, Peng L, Ren X, Ding K.. (2016) 4-Oxo-1,4-dihydroquinoline-3-carboxamide Derivatives as New Axl Kinase Inhibitors., 59 (14): [PMID:27379978 ] [10.1021/acs.jmedchem.6b00608 ]