Methyl-3-((3-fluoro-4-((5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)phenyl)carbamoyl)-1,2-dimethyl-4-oxo-1,4-dihydroquinoline-6-carboxylate

ID: ALA4474599

PubChem CID: 126617672

Max Phase: Preclinical

Molecular Formula: C32H24FN5O5

Molecular Weight: 577.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc2c(c1)c(=O)c(C(=O)Nc1ccc(Oc3ncnc4[nH]cc(-c5ccccc5)c34)c(F)c1)c(C)n2C

Standard InChI:  InChI=1S/C32H24FN5O5/c1-17-26(28(39)21-13-19(32(41)42-3)9-11-24(21)38(17)2)30(40)37-20-10-12-25(23(33)14-20)43-31-27-22(18-7-5-4-6-8-18)15-34-29(27)35-16-36-31/h4-16H,1-3H3,(H,37,40)(H,34,35,36)

Standard InChI Key:  FQAAJFWBYKMHIY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
   25.3133   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0304   -2.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0274   -1.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3114   -1.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5979   -2.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6019   -1.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8947   -1.2720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1788   -1.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1747   -2.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8864   -2.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4572   -2.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8835   -3.7449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7445   -2.4929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4522   -3.7358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0270   -2.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3179   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6008   -2.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5953   -3.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3131   -4.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0271   -3.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8783   -4.1265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8745   -4.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8665   -6.6008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5860   -6.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5867   -5.3634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1529   -6.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1570   -5.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3778   -5.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8919   -5.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3711   -6.4335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1251   -4.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6824   -3.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4318   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6243   -2.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0677   -3.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3214   -4.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9000   -0.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4664   -1.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8885   -2.4729    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.7461   -2.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7474   -3.7457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4605   -2.5060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1762   -2.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 10 12  2  0
 11 13  1  0
 11 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 27  2  0
 26 23  2  0
 23 24  1  0
 24 25  2  0
 25 22  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 28 31  1  0
  7 37  1  0
  8 38  1  0
 17 39  1  0
  2 40  1  0
 40 41  2  0
 40 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474599

    ---

Associated Targets(Human)

AXL Tchem Tyrosine-protein kinase receptor UFO (3469 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 577.57Molecular Weight (Monoisotopic): 577.1761AlogP: 5.76#Rotatable Bonds: 6
Polar Surface Area: 128.20Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.46CX Basic pKa: 3.43CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.24Np Likeness Score: -1.12

References

1. Tan L, Zhang Z, Gao D, Luo J, Tu ZC, Li Z, Peng L, Ren X, Ding K..  (2016)  4-Oxo-1,4-dihydroquinoline-3-carboxamide Derivatives as New Axl Kinase Inhibitors.,  59  (14): [PMID:27379978] [10.1021/acs.jmedchem.6b00608]

Source