The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(5-(7-Methoxy-5-methylbenzo[b]thiophen-2-yl)-4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)pyrrolidin-1-yl)prop-2-en-1-one ID: ALA4474645
PubChem CID: 132245876
Max Phase: Preclinical
Molecular Formula: C24H25N5O2S
Molecular Weight: 447.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCC(n2cc(-c3cc4cc(C)cc(OC)c4s3)c3c(NC)ncnc32)C1
Standard InChI: InChI=1S/C24H25N5O2S/c1-5-20(30)28-7-6-16(11-28)29-12-17(21-23(25-3)26-13-27-24(21)29)19-10-15-8-14(2)9-18(31-4)22(15)32-19/h5,8-10,12-13,16H,1,6-7,11H2,2-4H3,(H,25,26,27)
Standard InChI Key: KSJXHYQHYJPCLP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
28.8273 -7.1937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8261 -8.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5383 -8.4305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5365 -6.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2493 -7.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2541 -8.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0382 -8.2613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5156 -7.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0305 -6.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5341 -5.9635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2784 -6.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0557 -5.8933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.7876 -5.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2681 -4.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0491 -5.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6552 -4.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4815 -3.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6963 -3.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0935 -4.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4379 -4.7693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6120 -5.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5148 -2.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2953 -9.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8227 -9.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3069 -10.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0868 -10.1138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0819 -9.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7950 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7950 -11.3416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5068 -10.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5068 -9.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8210 -5.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
9 11 1 0
11 12 1 0
12 15 1 0
14 13 1 0
13 11 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
20 21 1 0
18 22 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
26 28 1 0
28 29 2 0
28 30 1 0
30 31 2 0
10 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.56Molecular Weight (Monoisotopic): 447.1729AlogP: 4.63#Rotatable Bonds: 5Polar Surface Area: 72.28Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.32CX LogP: 3.63CX LogD: 3.60Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -0.68
References 1. Wang Y, Li L, Fan J, Dai Y, Jiang A, Geng M, Ai J, Duan W.. (2018) Discovery of Potent Irreversible Pan-Fibroblast Growth Factor Receptor (FGFR) Inhibitors., 61 (20): [PMID:29522671 ] [10.1021/acs.jmedchem.7b01843 ]