1-(3-(5-(7-Methoxy-5-methylbenzo[b]thiophen-2-yl)-4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)pyrrolidin-1-yl)prop-2-en-1-one

ID: ALA4474645

PubChem CID: 132245876

Max Phase: Preclinical

Molecular Formula: C24H25N5O2S

Molecular Weight: 447.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1CCC(n2cc(-c3cc4cc(C)cc(OC)c4s3)c3c(NC)ncnc32)C1

Standard InChI:  InChI=1S/C24H25N5O2S/c1-5-20(30)28-7-6-16(11-28)29-12-17(21-23(25-3)26-13-27-24(21)29)19-10-15-8-14(2)9-18(31-4)22(15)32-19/h5,8-10,12-13,16H,1,6-7,11H2,2-4H3,(H,25,26,27)

Standard InChI Key:  KSJXHYQHYJPCLP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   28.8273   -7.1937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8261   -8.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5383   -8.4305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5365   -6.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2493   -7.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2541   -8.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0382   -8.2613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5156   -7.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0305   -6.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5341   -5.9635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2784   -6.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0557   -5.8933    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.7876   -5.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2681   -4.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0491   -5.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6552   -4.5209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4815   -3.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6963   -3.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0935   -4.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4379   -4.7693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6120   -5.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5148   -2.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2953   -9.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8227   -9.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3069  -10.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0868  -10.1138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0819   -9.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7950  -10.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7950  -11.3416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5068  -10.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5068   -9.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8210   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  1  0
  9 11  1  0
 11 12  1  0
 12 15  1  0
 14 13  1  0
 13 11  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 16 20  1  0
 20 21  1  0
 18 22  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 26 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 10 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474645

    ---

Associated Targets(Human)

FGFR1 Tclin Fibroblast growth factor receptor 1 (9149 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FGFR4 Tclin Fibroblast growth factor receptor 4 (3668 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.56Molecular Weight (Monoisotopic): 447.1729AlogP: 4.63#Rotatable Bonds: 5
Polar Surface Area: 72.28Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.32CX LogP: 3.63CX LogD: 3.60
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -0.68

References

1. Wang Y, Li L, Fan J, Dai Y, Jiang A, Geng M, Ai J, Duan W..  (2018)  Discovery of Potent Irreversible Pan-Fibroblast Growth Factor Receptor (FGFR) Inhibitors.,  61  (20): [PMID:29522671] [10.1021/acs.jmedchem.7b01843]

Source