The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{4-[(2-Aminophenyl)carbamoyl]benzyl}-N-[2-(benzylamino)-2-oxoethyl]-4-(dimethyl-amino)benzamide ID: ALA4474656
PubChem CID: 155537112
Max Phase: Preclinical
Molecular Formula: C32H33N5O3
Molecular Weight: 535.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C(=O)N(CC(=O)NCc2ccccc2)Cc2ccc(C(=O)Nc3ccccc3N)cc2)cc1
Standard InChI: InChI=1S/C32H33N5O3/c1-36(2)27-18-16-26(17-19-27)32(40)37(22-30(38)34-20-23-8-4-3-5-9-23)21-24-12-14-25(15-13-24)31(39)35-29-11-7-6-10-28(29)33/h3-19H,20-22,33H2,1-2H3,(H,34,38)(H,35,39)
Standard InChI Key: SIRNCVDOMIOFAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
8.0449 -5.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7571 -4.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4612 -5.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4612 -5.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7555 -6.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0449 -5.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1693 -6.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8774 -5.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1693 -7.1479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8774 -7.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5898 -7.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2943 -7.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2943 -8.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5924 -8.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8774 -8.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5898 -6.3287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3369 -4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6288 -5.1019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9166 -4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9166 -3.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2085 -3.4630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5005 -3.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7924 -3.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0800 -3.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3755 -3.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3755 -2.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0815 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7924 -2.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6288 -3.4630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6288 -5.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3369 -6.3290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9166 -6.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9163 -7.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2107 -7.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5023 -7.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5001 -6.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2083 -5.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7943 -7.5533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7943 -8.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0821 -7.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
11 16 1 0
1 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
20 29 2 0
18 30 1 0
30 31 2 0
30 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
35 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.65Molecular Weight (Monoisotopic): 535.2583AlogP: 4.55#Rotatable Bonds: 10Polar Surface Area: 107.77Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.67CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.48
References 1. Krieger V, Hamacher A, Cao F, Stenzel K, Gertzen CGW, Schäker-Hübner L, Kurz T, Gohlke H, Dekker FJ, Kassack MU, Hansen FK.. (2019) Synthesis of Peptoid-Based Class I-Selective Histone Deacetylase Inhibitors with Chemosensitizing Properties., 62 (24): [PMID:31762274 ] [10.1021/acs.jmedchem.9b01489 ]