The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(((6-((4-Chlorobenzyl)thio)-4-oxo-4,5-dihydro-1,3,5-triazin-2-yl)thio)methyl)benzamide ID: ALA4474662
PubChem CID: 155537116
Max Phase: Preclinical
Molecular Formula: C18H15ClN4O2S2
Molecular Weight: 418.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1cccc(CSc2nc(SCc3ccc(Cl)cc3)[nH]c(=O)n2)c1
Standard InChI: InChI=1S/C18H15ClN4O2S2/c19-14-6-4-11(5-7-14)9-26-17-21-16(25)22-18(23-17)27-10-12-2-1-3-13(8-12)15(20)24/h1-8H,9-10H2,(H2,20,24)(H,21,22,23,25)
Standard InChI Key: QAABXKHKJDTRSD-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
20.9319 -20.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9307 -21.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6388 -21.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3484 -21.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3456 -20.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6370 -19.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0518 -19.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0487 -19.0821 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.7549 -18.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4593 -19.0796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1633 -18.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1645 -17.8543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4554 -17.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7451 -17.8557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8710 -19.0805 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.8710 -19.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4551 -16.6290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5787 -20.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5766 -21.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2835 -21.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9921 -21.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9895 -20.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2821 -19.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6958 -19.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4049 -20.2977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6929 -19.0744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2227 -21.5418 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
13 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
24 26 2 0
2 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.93Molecular Weight (Monoisotopic): 418.0325AlogP: 3.50#Rotatable Bonds: 7Polar Surface Area: 101.73Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.53CX Basic pKa: ┄CX LogP: 4.26CX LogD: 3.36Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.57Np Likeness Score: -1.67
References 1. Bergant K, Janežič M, Valjavec K, Sosič I, Pajk S, Štampar M, Žegura B, Gobec S, Filipič M, Perdih A.. (2019) Structure-guided optimization of 4,6-substituted-1,3,5-triazin-2(1H)-ones as catalytic inhibitors of human DNA topoisomerase IIα., 175 [PMID:31096154 ] [10.1016/j.ejmech.2019.04.055 ]