(E)-3-(4-morpholino-3-(4-((4-(trifluoromethyl)phenoxy)methyl)-1H-1,2,3-triazol-1-yl)phenyl)but-2-enoic acid

ID: ALA4474728

PubChem CID: 155537087

Max Phase: Preclinical

Molecular Formula: C24H23F3N4O4

Molecular Weight: 488.47

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  C/C(=C\C(=O)O)c1ccc(N2CCOCC2)c(-n2cc(COc3ccc(C(F)(F)F)cc3)nn2)c1

Standard InChI:  InChI=1S/C24H23F3N4O4/c1-16(12-23(32)33)17-2-7-21(30-8-10-34-11-9-30)22(13-17)31-14-19(28-29-31)15-35-20-5-3-18(4-6-20)24(25,26)27/h2-7,12-14H,8-11,15H2,1H3,(H,32,33)/b16-12+

Standard InChI Key:  LMKOYBYFYAAQBJ-FOWTUZBSSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   37.1767   -4.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1755   -5.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8836   -6.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5932   -5.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5904   -4.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8818   -4.5603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4689   -4.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4687   -3.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7612   -4.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0534   -4.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3458   -4.9698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0532   -3.7439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3016   -6.1957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2986   -7.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0029   -7.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7124   -7.0142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7130   -6.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0042   -5.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2962   -4.5518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0439   -4.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5885   -4.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1772   -3.5658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.3785   -3.7388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4044   -4.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8127   -3.5638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6299   -3.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0363   -4.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8527   -4.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2618   -3.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8486   -2.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0335   -2.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0790   -3.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4888   -4.2690    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.4864   -2.8536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.8948   -3.5618    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
  5 19  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4474728

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 488.47

Molecular Weight (Monoisotopic): 488.1671

AlogP: 4.19

#Rotatable Bonds: 7

Polar Surface Area: 89.71

Molecular Species: ACID

HBA: 7

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 3.64

CX Basic pKa: 0.19

CX LogP: 4.56

CX LogD: 1.23

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.50

Np Likeness Score: -1.26

References

1. Hu H, Li M, Wu D, Li Z, Miao R, Liu Y, Gong P..  (2019)  Design, synthesis and biological evaluation of novel aryl-acrylic derivatives as novel indoleamine-2,3-dioxygenase 1 (IDO1) inhibitors.,  27  (14): [PMID:31178268] [10.1016/j.bmc.2019.05.048]

Source

Source(1):

• Scientific Literature