The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclopentyl-2-(5-methoxy-2-methyl-3-(2-morpholinoethyl)-1H-indol-1-yl)acetamide ID: ALA4474733
PubChem CID: 155537091
Max Phase: Preclinical
Molecular Formula: C23H33N3O3
Molecular Weight: 399.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c(CCN1CCOCC1)c(C)n2CC(=O)NC1CCCC1
Standard InChI: InChI=1S/C23H33N3O3/c1-17-20(9-10-25-11-13-29-14-12-25)21-15-19(28-2)7-8-22(21)26(17)16-23(27)24-18-5-3-4-6-18/h7-8,15,18H,3-6,9-14,16H2,1-2H3,(H,24,27)
Standard InChI Key: KYZMIFYSFCDHPA-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
3.6966 -17.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6954 -17.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4076 -18.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4058 -16.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1186 -17.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1188 -17.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9016 -18.2453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3826 -17.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9012 -16.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1534 -16.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9568 -15.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2091 -15.1795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0150 -15.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2721 -14.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7239 -13.6256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9192 -13.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6627 -14.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1561 -19.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9559 -19.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5011 -18.5810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1998 -17.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2104 -19.9663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6651 -20.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9884 -16.7656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9875 -15.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8562 -20.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5257 -21.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1345 -21.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8410 -21.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
7 18 1 0
18 19 1 0
19 20 2 0
8 21 1 0
19 22 1 0
22 23 1 0
1 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.54Molecular Weight (Monoisotopic): 399.2522AlogP: 2.89#Rotatable Bonds: 7Polar Surface Area: 55.73Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.28CX LogP: 2.60CX LogD: 2.35Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.78Np Likeness Score: -1.43
References 1. Li J, Ji J, Xu R, Li Z.. (2019) Indole compounds with N -ethyl morpholine moieties as CB2 receptor agonists for anti-inflammatory management of pain: synthesis and biological evaluation., 10 (11): [PMID:32952995 ] [10.1039/C9MD00173E ]