The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Anilino-4-{[1-(5-cyanopyridin-2-yl)piperidin-4-yl]amino}nicotinamide ID: ALA4474752
PubChem CID: 155537151
Max Phase: Preclinical
Molecular Formula: C23H23N7O
Molecular Weight: 413.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(N2CCC(Nc3cc(Nc4ccccc4)ncc3C(N)=O)CC2)nc1
Standard InChI: InChI=1S/C23H23N7O/c24-13-16-6-7-22(27-14-16)30-10-8-18(9-11-30)28-20-12-21(26-15-19(20)23(25)31)29-17-4-2-1-3-5-17/h1-7,12,14-15,18H,8-11H2,(H2,25,31)(H2,26,28,29)
Standard InChI Key: DCHOIOVTXGTPJC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
15.9792 -8.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9781 -8.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6861 -9.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3958 -8.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3929 -8.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6843 -7.7713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2714 -7.7717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5638 -8.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8561 -7.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1490 -8.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1487 -8.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8615 -9.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5657 -8.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6859 -10.2258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9781 -10.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2739 -10.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5682 -10.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5638 -11.4456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2712 -11.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9831 -11.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1041 -9.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1054 -10.2239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8112 -8.9970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8544 -11.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1503 -11.4387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4415 -11.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4377 -12.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1488 -13.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8547 -12.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7332 -13.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0244 -13.4748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 14 1 0
15 14 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
4 21 1 0
21 22 2 0
21 23 1 0
18 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
30 31 3 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.49Molecular Weight (Monoisotopic): 413.1964AlogP: 3.27#Rotatable Bonds: 6Polar Surface Area: 119.96Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.12CX LogP: 2.91CX LogD: 2.19Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -1.90
References 1. Nakajima Y, Aoyama N, Takahashi F, Sasaki H, Hatanaka K, Moritomo A, Inami M, Ito M, Nakamura K, Nakamori F, Inoue T, Shirakami S.. (2016) Design, synthesis, and evaluation of 4,6-diaminonicotinamide derivatives as novel and potent immunomodulators targeting JAK3., 24 (19): [PMID:27544589 ] [10.1016/j.bmc.2016.08.007 ]