2-(2-(1H-1,2,4-triazol-1-yl)-5-(trifluoromethoxy)phenyl)-5-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-1,3,4-oxadiazole

ID: ALA4474756

PubChem CID: 155537155

Max Phase: Preclinical

Molecular Formula: C19H12F3N5O4

Molecular Weight: 431.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  FC(F)(F)Oc1ccc(-n2cncn2)c(-c2nnc(-c3ccc4c(c3)OCCO4)o2)c1

Standard InChI:  InChI=1S/C19H12F3N5O4/c20-19(21,22)31-12-2-3-14(27-10-23-9-24-27)13(8-12)18-26-25-17(30-18)11-1-4-15-16(7-11)29-6-5-28-15/h1-4,7-10H,5-6H2

Standard InChI Key:  JULCEJMERFVYQF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    3.6253  -12.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5009  -11.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4997  -12.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2078  -12.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9175  -12.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9146  -11.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2060  -10.9699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2036  -10.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9101   -9.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9076   -8.9248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6190  -10.1485    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6155   -9.3275    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2076  -13.4244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5477  -13.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000  -14.6845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6173  -14.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8699  -13.9076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7090  -13.4245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5089  -13.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9191  -12.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3726  -12.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7327  -12.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1400  -13.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9529  -13.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1332  -12.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9416  -12.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3531  -12.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1637  -12.8758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5689  -12.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1573  -11.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3406  -11.4687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
  9 12  1  0
  5  1  1  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  1 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21  1  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 27  2  0
 26 25  2  0
 25 22  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474756

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.33Molecular Weight (Monoisotopic): 431.0841AlogP: 3.65#Rotatable Bonds: 4
Polar Surface Area: 97.32Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.54CX LogP: 3.35CX LogD: 3.35
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.45

References

1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278.,  29  (10): [PMID:30910459] [10.1016/j.bmcl.2019.03.016]

Source