The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-Dibutyl-3,3'-[4,4'-tricyclo[3.3.1.1(3,7)]decan-1,3-diyl)bis(phenoxy)bis(1-amino-2-propanol) ID: ALA4474758
PubChem CID: 155537156
Max Phase: Preclinical
Molecular Formula: C36H54N2O4
Molecular Weight: 578.84
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNCC(O)COc1ccc(C23CC4CC(C2)CC(c2ccc(OCC(O)CNCCCC)cc2)(C4)C3)cc1
Standard InChI: InChI=1S/C36H54N2O4/c1-3-5-15-37-22-31(39)24-41-33-11-7-29(8-12-33)35-18-27-17-28(19-35)21-36(20-27,26-35)30-9-13-34(14-10-30)42-25-32(40)23-38-16-6-4-2/h7-14,27-28,31-32,37-40H,3-6,15-26H2,1-2H3
Standard InChI Key: SVMUZCUKOXZYHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
16.0753 -16.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9924 -18.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6275 -17.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7892 -18.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3322 -17.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5348 -18.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0729 -17.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7824 -17.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3378 -16.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6231 -16.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3327 -15.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0418 -15.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0370 -14.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3244 -14.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6153 -14.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6236 -15.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3182 -13.2669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0227 -12.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0165 -12.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7210 -11.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3056 -11.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4318 -12.0249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1315 -11.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7772 -18.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7742 -18.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4777 -19.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1831 -18.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1807 -18.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4767 -17.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8913 -19.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5985 -18.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3067 -19.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0140 -18.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3076 -20.1030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7221 -19.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4267 -18.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8450 -12.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5467 -11.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2603 -11.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1369 -19.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8421 -18.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5523 -19.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 7 1 0
6 7 1 0
8 9 1 0
4 8 1 0
3 10 1 0
7 1 1 0
1 9 1 0
9 10 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
20 22 1 0
22 23 1 0
7 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
33 35 1 0
35 36 1 0
23 37 1 0
37 38 1 0
38 39 1 0
36 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.84Molecular Weight (Monoisotopic): 578.4084AlogP: 5.74#Rotatable Bonds: 18Polar Surface Area: 82.98Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.79CX Basic pKa: 10.06CX LogP: 6.10CX LogD: 1.49Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.17
References 1. Georgiadis MO, Kourbeli V, Ioannidou V, Karakitsios E, Papanastasiou I, Tsotinis A, Komiotis D, Vocat A, Cole ST, Taylor MC, Kelly JM.. (2019) Synthesis of diphenoxyadamantane alkylamines with pharmacological interest., 29 (11): [PMID:30981579 ] [10.1016/j.bmcl.2019.04.010 ]