The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(hydroxyamino)-4-oxobutyl)-3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)benzamide ID: ALA4474772
PubChem CID: 155537200
Max Phase: Preclinical
Molecular Formula: C21H23N3O5S
Molecular Weight: 429.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCC(=O)NO)c1
Standard InChI: InChI=1S/C21H23N3O5S/c1-29-17-9-3-2-8-16(17)24-19(26)13-30-21(24)15-7-4-6-14(12-15)20(27)22-11-5-10-18(25)23-28/h2-4,6-9,12,21,28H,5,10-11,13H2,1H3,(H,22,27)(H,23,25)
Standard InChI Key: GHWXGAVZLFAGAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
31.6723 -3.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4895 -3.7971 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.7439 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0809 -2.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4222 -3.0204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0797 -1.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6471 -2.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4779 -1.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7014 -1.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0934 -2.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2671 -3.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0434 -3.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1917 -4.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3781 -4.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8971 -5.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2284 -5.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0455 -5.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5229 -5.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0855 -1.4237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9160 -0.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3796 -6.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9007 -7.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1925 -6.6880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5265 -7.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3394 -7.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6735 -8.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4864 -8.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8204 -9.0926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9652 -7.6846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6333 -9.1762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
1 13 1 0
8 19 1 0
19 20 1 0
17 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.50Molecular Weight (Monoisotopic): 429.1358AlogP: 2.49#Rotatable Bonds: 8Polar Surface Area: 107.97Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 1.29CX LogD: 1.28Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.98
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]