N-(4-(hydroxyamino)-4-oxobutyl)-3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)benzamide

ID: ALA4474772

PubChem CID: 155537200

Max Phase: Preclinical

Molecular Formula: C21H23N3O5S

Molecular Weight: 429.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCC(=O)NO)c1

Standard InChI:  InChI=1S/C21H23N3O5S/c1-29-17-9-3-2-8-16(17)24-19(26)13-30-21(24)15-7-4-6-14(12-15)20(27)22-11-5-10-18(25)23-28/h2-4,6-9,12,21,28H,5,10-11,13H2,1H3,(H,22,27)(H,23,25)

Standard InChI Key:  GHWXGAVZLFAGAC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   31.6723   -3.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4895   -3.7971    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.7439   -3.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0809   -2.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4222   -3.0204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0797   -1.7211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6471   -2.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4779   -1.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7014   -1.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0934   -2.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2671   -3.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0434   -3.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1917   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3781   -4.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8971   -5.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2284   -5.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0455   -5.8586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5229   -5.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0855   -1.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9160   -0.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3796   -6.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9007   -7.2665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1925   -6.6880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5265   -7.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3394   -7.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6735   -8.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4864   -8.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8204   -9.0926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9652   -7.6846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6333   -9.1762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 13  1  0
  8 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474772

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase 1 (10854 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.50Molecular Weight (Monoisotopic): 429.1358AlogP: 2.49#Rotatable Bonds: 8
Polar Surface Area: 107.97Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.91CX Basic pKa: CX LogP: 1.29CX LogD: 1.28
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.98

References

1. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

Source