The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(tert-Butyl)-3-(3-(dimethylamino)propyl)-8-(2-fluorophenyl)-3H-imidazo[2,1-i]purin-7-amine ID: ALA4474788
PubChem CID: 155537281
Max Phase: Preclinical
Molecular Formula: C22H28FN7
Molecular Weight: 409.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCn1cnc2c1ncn1c(NC(C)(C)C)c(-c3ccccc3F)nc21
Standard InChI: InChI=1S/C22H28FN7/c1-22(2,3)27-21-17(15-9-6-7-10-16(15)23)26-20-18-19(25-14-30(20)21)29(13-24-18)12-8-11-28(4)5/h6-7,9-10,13-14,27H,8,11-12H2,1-5H3
Standard InChI Key: JROVIAPUTQWNSZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
31.2885 -20.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9979 -21.0943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2862 -19.8646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9979 -19.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8236 -18.6482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0067 -18.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6747 -19.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7032 -19.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7077 -20.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4870 -20.9335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9659 -20.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4798 -19.6129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8756 -19.4847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6240 -20.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8248 -20.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1715 -20.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4065 -21.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5969 -17.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0080 -17.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5989 -16.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7808 -16.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3736 -17.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7850 -17.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7439 -21.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2005 -22.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4574 -23.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9141 -23.7057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1710 -24.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1138 -23.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8252 -17.1514 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3 1 1 0
1 2 2 0
2 9 1 0
8 4 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 3 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
6 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
19 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.51Molecular Weight (Monoisotopic): 409.2390AlogP: 4.05#Rotatable Bonds: 6Polar Surface Area: 63.28Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.66CX LogP: 2.31CX LogD: 0.07Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.52
References 1. Pelliccia S, Amato J, Capasso D, Di Gaetano S, Massarotti A, Piccolo M, Irace C, Tron GC, Pagano B, Randazzo A, Novellino E, Giustiniano M.. (2020) Bio-Inspired Dual-Selective BCL-2 /c-MYC G-Quadruplex Binders: Design, Synthesis, and Anticancer Activity of Drug-like Imidazo[2,1-i ]purine Derivatives., 63 (5): [PMID:31241946 ] [10.1021/acs.jmedchem.9b00262 ]