The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(4-Oxo-4H-chromen-7-yl)oxy]-N-{3-[4-(trifluoromethoxy)benzenesulfonamido]phenyl}acetamide ID: ALA4474804
PubChem CID: 155537163
Max Phase: Preclinical
Molecular Formula: C24H17F3N2O7S
Molecular Weight: 534.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc2c(=O)ccoc2c1)Nc1cccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)c1
Standard InChI: InChI=1S/C24H17F3N2O7S/c25-24(26,27)36-17-4-7-19(8-5-17)37(32,33)29-16-3-1-2-15(12-16)28-23(31)14-35-18-6-9-20-21(30)10-11-34-22(20)13-18/h1-13,29H,14H2,(H,28,31)
Standard InChI Key: CLMQDFHHJKSIMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
7.9787 -7.1033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5721 -6.3934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1593 -7.1033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8600 -5.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8600 -5.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1491 -4.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4472 -5.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7350 -4.7547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0270 -5.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3189 -4.7547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0270 -5.9859 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3189 -5.5741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4472 -5.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1517 -6.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2802 -5.9856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9883 -6.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9883 -7.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6989 -7.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4046 -7.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4046 -6.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1127 -5.9851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8207 -6.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8207 -7.2122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5288 -5.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2410 -6.3928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9491 -5.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6615 -6.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3698 -5.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0739 -6.3891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7800 -5.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7800 -5.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0694 -4.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0694 -3.9382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3698 -5.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6550 -4.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9491 -5.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6963 -5.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
9 12 1 0
7 13 2 0
13 14 1 0
14 4 2 0
15 2 1 0
16 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
34 32 1 0
28 34 1 0
34 35 2 0
35 36 1 0
36 26 2 0
20 37 1 0
37 16 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.47Molecular Weight (Monoisotopic): 534.0709AlogP: 4.51#Rotatable Bonds: 8Polar Surface Area: 123.94Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.90CX Basic pKa: ┄CX LogP: 4.34CX LogD: 4.24Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.32
References 1. Zhao L, Li Y, Wang Y, Qiao Z, Miao Z, Yang J, Huang L, Tian C, Li L, Chen D, Yang S.. (2019) Discovery of 4H-Chromen-4-one Derivatives as a New Class of Selective Rho Kinase (ROCK) Inhibitors, which Showed Potent Activity in ex Vivo Diabetic Retinopathy Models., 62 (23): [PMID:31693351 ] [10.1021/acs.jmedchem.9b01143 ]