2-(4-((4-benzylpiperazin-1-yl)methyl)phenyl)benzo[d]oxazole

ID: ALA4474812

PubChem CID: 126961652

Max Phase: Preclinical

Molecular Formula: C25H25N3O

Molecular Weight: 383.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CN2CCN(Cc3ccc(-c4nc5ccccc5o4)cc3)CC2)cc1

Standard InChI:  InChI=1S/C25H25N3O/c1-2-6-20(7-3-1)18-27-14-16-28(17-15-27)19-21-10-12-22(13-11-21)25-26-23-8-4-5-9-24(23)29-25/h1-13H,14-19H2

Standard InChI Key:  FWMODKNVZLANTI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   28.0555  -17.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0543  -18.5790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7624  -18.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7606  -17.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4692  -17.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4740  -18.5790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2584  -18.8288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7384  -18.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2506  -17.4969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5536  -18.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9657  -18.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7822  -18.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1874  -18.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7702  -17.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9552  -17.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0046  -18.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4183  -18.8427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0124  -19.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4227  -20.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2402  -20.2516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6458  -19.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2339  -18.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6512  -20.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4656  -20.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8751  -21.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6887  -21.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0894  -20.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6705  -20.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8582  -20.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 24 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474812

    ---

Associated Targets(non-human)

ache Acetylcholinesterase (12221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.50Molecular Weight (Monoisotopic): 383.1998AlogP: 4.81#Rotatable Bonds: 5
Polar Surface Area: 32.51Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.87CX LogP: 4.86CX LogD: 4.26
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.13

References

1. Srivastava P, Tripathi PN, Sharma P, Rai SN, Singh SP, Srivastava RK, Shankar S, Shrivastava SK..  (2019)  Design and development of some phenyl benzoxazole derivatives as a potent acetylcholinesterase inhibitor with antioxidant property to enhance learning and memory.,  163  [PMID:30503937] [10.1016/j.ejmech.2018.11.049]

Source