The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-Methyl-5-oxo-4-((5-(3-oxo-2,3-dihydro-1H-inden-4-yl)furan-2-yl)methylene)-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid ID: ALA4474848
PubChem CID: 155537172
Max Phase: Preclinical
Molecular Formula: C25H18N2O5
Molecular Weight: 426.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(-c2cccc3c2C(=O)CC3)o1
Standard InChI: InChI=1S/C25H18N2O5/c1-14-20(24(29)27(26-14)17-8-5-16(6-9-17)25(30)31)13-18-10-12-22(32-18)19-4-2-3-15-7-11-21(28)23(15)19/h2-6,8-10,12-13H,7,11H2,1H3,(H,30,31)/b20-13-
Standard InChI Key: WHYQTFFTGCKZHP-MOSHPQCFSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
14.0640 -26.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0629 -26.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7785 -27.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4959 -26.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4931 -26.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7768 -25.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7712 -24.9021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4383 -24.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1821 -23.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3566 -23.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1012 -24.4172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6629 -22.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4841 -23.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8975 -23.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7045 -23.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7878 -22.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0324 -22.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3155 -24.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1457 -24.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7610 -25.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5465 -25.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2242 -24.6688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8677 -22.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7783 -28.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0670 -28.6104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4896 -28.6107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0964 -23.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7119 -24.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4169 -24.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2371 -23.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4210 -23.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0002 -22.4178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
6 7 1 0
9 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 28 1 0
27 18 1 0
15 18 1 0
8 22 2 0
10 23 1 0
3 24 1 0
24 25 1 0
24 26 2 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.43Molecular Weight (Monoisotopic): 426.1216AlogP: 4.58#Rotatable Bonds: 4Polar Surface Area: 100.18Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.98CX Basic pKa: ┄CX LogP: 3.73CX LogD: 0.56Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -0.75
References 1. Liu R, Zhang Z, Yang H, Zhou K, Geng M, Zhou W, Zhang M, Huang X, Li Y.. (2019) Design, synthesis, and biological evaluation of a new class of histone acetyltransferase p300 inhibitors., 180 [PMID:31306905 ] [10.1016/j.ejmech.2019.07.026 ]