The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl-(S)-2-(2-(1-benzoylpiperidin-4-yl)acetamido)-3-(4-(benzyloxy)phenyl)propanoate ID: ALA4474871
PubChem CID: 134355683
Max Phase: Preclinical
Molecular Formula: C31H34N2O5
Molecular Weight: 514.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)c2ccccc2)CC1
Standard InChI: InChI=1S/C31H34N2O5/c1-37-31(36)28(20-23-12-14-27(15-13-23)38-22-25-8-4-2-5-9-25)32-29(34)21-24-16-18-33(19-17-24)30(35)26-10-6-3-7-11-26/h2-15,24,28H,16-22H2,1H3,(H,32,34)/t28-/m0/s1
Standard InChI Key: DMWKVBQWFQZLBS-NDEPHWFRSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
18.5974 -10.6846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3108 -10.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0243 -10.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0243 -11.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3108 -11.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5974 -11.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7416 -11.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4548 -11.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4548 -10.6850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1679 -11.9250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8810 -11.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5983 -11.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3114 -11.5103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0246 -11.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5983 -12.7504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8810 -10.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5983 -10.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3118 -10.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0239 -10.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0230 -9.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3094 -9.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5927 -9.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7403 -9.0380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4535 -9.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1666 -9.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8802 -9.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5922 -9.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5954 -8.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8819 -7.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1652 -8.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8801 -10.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1670 -10.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4534 -10.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7414 -10.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7423 -11.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4558 -11.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1725 -11.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8801 -9.4487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
11 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
17 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
1 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
32 37 1 0
31 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.62Molecular Weight (Monoisotopic): 514.2468AlogP: 4.41#Rotatable Bonds: 10Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.10CX Basic pKa: ┄CX LogP: 4.37CX LogD: 4.37Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: -0.77
References 1. (2018) Yap1 inhibitors that target the interaction of yap1 with oct4,