Methyl-(S)-2-(2-(1-benzoylpiperidin-4-yl)acetamido)-3-(4-(benzyloxy)phenyl)propanoate

ID: ALA4474871

PubChem CID: 134355683

Max Phase: Preclinical

Molecular Formula: C31H34N2O5

Molecular Weight: 514.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)c2ccccc2)CC1

Standard InChI:  InChI=1S/C31H34N2O5/c1-37-31(36)28(20-23-12-14-27(15-13-23)38-22-25-8-4-2-5-9-25)32-29(34)21-24-16-18-33(19-17-24)30(35)26-10-6-3-7-11-26/h2-15,24,28H,16-22H2,1H3,(H,32,34)/t28-/m0/s1

Standard InChI Key:  DMWKVBQWFQZLBS-NDEPHWFRSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   18.5974  -10.6846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3108  -10.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0243  -10.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0243  -11.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3108  -11.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5974  -11.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7416  -11.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4548  -11.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4548  -10.6850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1679  -11.9250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8810  -11.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5983  -11.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3114  -11.5103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0246  -11.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5983  -12.7504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8810  -10.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5983  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3118  -10.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0239  -10.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0230   -9.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3094   -9.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5927   -9.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7403   -9.0380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4535   -9.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1666   -9.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8802   -9.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5922   -9.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5954   -8.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8819   -7.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1652   -8.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8801  -10.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1670  -10.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4534  -10.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7414  -10.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7423  -11.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4558  -11.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1725  -11.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8801   -9.4487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  2  0
 11 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  1 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 32 37  1  0
 31 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4474871

    ---

Associated Targets(Human)

NCI-H1650 (1118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
YAP1 Tchem Transcriptional coactivator YAP1 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.62Molecular Weight (Monoisotopic): 514.2468AlogP: 4.41#Rotatable Bonds: 10
Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.10CX Basic pKa: CX LogP: 4.37CX LogD: 4.37
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: -0.77

References

1.  (2018)  Yap1 inhibitors that target the interaction of yap1 with oct4, 

Source