beta-D-Galactopyranosyl-16-oxo-ent-beyeran-19-oate

ID: ALA4474882

PubChem CID: 155537602

Max Phase: Preclinical

Molecular Formula: C26H40O8

Molecular Weight: 480.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12CC[C@@H]3[C@@](CC[C@H]4[C@@]3(C)CCC[C@@]4(C)C(=O)O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)(CC1=O)C2

Standard InChI:  InChI=1S/C26H40O8/c1-23-9-5-16-24(2)7-4-8-25(3,15(24)6-10-26(16,13-23)11-17(23)28)22(32)34-21-20(31)19(30)18(29)14(12-27)33-21/h14-16,18-21,27,29-31H,4-13H2,1-3H3/t14-,15+,16+,18+,19+,20-,21+,23+,24-,25-,26+/m1/s1

Standard InChI Key:  MXPANPFFHMVCBQ-KYJHCELBSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   15.3113  -19.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1285  -19.2711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5349  -18.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1324  -17.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9046  -18.5600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3152  -17.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5460  -17.1557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5361  -19.9793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3521  -18.5691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9007  -19.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9106  -17.1433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0945  -17.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6900  -16.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2852  -17.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9925  -15.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9925  -16.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6937  -14.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3948  -15.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3913  -16.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0893  -16.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7952  -16.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0962  -14.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7987  -15.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5106  -14.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5221  -14.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8156  -13.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1015  -14.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0950  -14.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5791  -15.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3875  -14.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6349  -13.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9020  -14.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3834  -16.8473    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0891  -15.6339    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6854  -17.8478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0835  -19.9731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  1  5  1  0
  5  6  1  0
  4  7  1  6
  2  8  1  1
  3  9  1  1
  1 10  1  1
  6 11  1  1
 13 12  1  6
 14 13  1  0
 15 16  1  0
 15 17  1  0
 16 13  1  0
 13 19  1  0
 18 17  1  0
 18 19  1  0
 18 22  1  0
 19 20  1  0
 20 21  1  0
 21 23  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 23 29  1  6
 29 28  1  0
 18 30  1  6
 25 31  1  1
 28 32  2  0
 19 33  1  1
 22 34  1  1
 12 35  2  0
 12 11  1  0
 10 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474882

    ---

Associated Targets(Human)

M-HeLa (156 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 480.60Molecular Weight (Monoisotopic): 480.2723AlogP: 1.70#Rotatable Bonds: 3
Polar Surface Area: 133.52Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: 2.23CX LogD: 2.23
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: 2.88

References

1. Sharipova RR, Belenok MG, Garifullin BF, Sapunova AS, Voloshina AD, Andreeva OV, Strobykina IY, Skvortsova PV, Zuev YF, Kataev VE..  (2019)  Synthesis and anti-cancer activities of glycosides and glycoconjugates of diterpenoid isosteviol.,  10  (8): [PMID:31673312] [10.1039/C9MD00242A]

Source