The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-Benzofuranyl)-8-hydroxy-7-(3-(morpholin-4-yl)propanamido)quinoline ID: ALA4474912
PubChem CID: 155537498
Max Phase: Preclinical
Molecular Formula: C24H23N3O4
Molecular Weight: 417.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCN1CCOCC1)Nc1ccc2c(-c3cc4ccccc4o3)ccnc2c1O
Standard InChI: InChI=1S/C24H23N3O4/c28-22(8-10-27-11-13-30-14-12-27)26-19-6-5-18-17(7-9-25-23(18)24(19)29)21-15-16-3-1-2-4-20(16)31-21/h1-7,9,15,29H,8,10-14H2,(H,26,28)
Standard InChI Key: FOXYYCJUQCUSPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
33.4798 -15.3023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1936 -14.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1908 -14.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4780 -13.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7676 -14.8933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7699 -14.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0599 -13.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3470 -14.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3487 -14.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0594 -15.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6378 -15.3052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9292 -14.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2183 -15.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9272 -14.0770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0606 -16.1175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4696 -12.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1287 -12.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8065 -12.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0556 -11.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8693 -11.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2741 -10.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8664 -10.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0496 -10.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6485 -10.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5107 -14.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8029 -15.3084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0952 -14.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8028 -16.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3875 -15.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3873 -16.1254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0950 -16.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
10 15 1 0
16 17 1 0
17 20 1 0
19 18 1 0
18 16 2 0
4 16 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
13 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
28 31 1 0
27 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1689AlogP: 4.01#Rotatable Bonds: 5Polar Surface Area: 87.83Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.06CX Basic pKa: 6.91CX LogP: 2.39CX LogD: 2.48Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.90
References 1. Abraham AD, Esquer H, Zhou Q, Tomlinson N, Hamill BD, Abbott JM, Li L, Pike LA, Rinaldetti S, Ramirez DA, Lunghofer PJ, Gomez JD, Schaack J, Nemkov T, D'Alessandro A, Hansen KC, Gustafson DL, Messersmith WA, LaBarbera DV.. (2019) Drug Design Targeting T-Cell Factor-Driven Epithelial-Mesenchymal Transition as a Therapeutic Strategy for Colorectal Cancer., 62 (22): [PMID:31675229 ] [10.1021/acs.jmedchem.9b01065 ]