4-(2-Benzofuranyl)-8-hydroxy-7-(3-(morpholin-4-yl)propanamido)quinoline

ID: ALA4474912

PubChem CID: 155537498

Max Phase: Preclinical

Molecular Formula: C24H23N3O4

Molecular Weight: 417.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCN1CCOCC1)Nc1ccc2c(-c3cc4ccccc4o3)ccnc2c1O

Standard InChI:  InChI=1S/C24H23N3O4/c28-22(8-10-27-11-13-30-14-12-27)26-19-6-5-18-17(7-9-25-23(18)24(19)29)21-15-16-3-1-2-4-20(16)31-21/h1-7,9,15,29H,8,10-14H2,(H,26,28)

Standard InChI Key:  FOXYYCJUQCUSPX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   33.4798  -15.3023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1936  -14.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1908  -14.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4780  -13.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7676  -14.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7699  -14.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0599  -13.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3470  -14.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3487  -14.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0594  -15.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6378  -15.3052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9292  -14.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2183  -15.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9272  -14.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0606  -16.1175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4696  -12.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1287  -12.3548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8065  -12.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0556  -11.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8693  -11.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2741  -10.8782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8664  -10.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0496  -10.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6485  -10.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5107  -14.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8029  -15.3084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0952  -14.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8028  -16.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3875  -15.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3873  -16.1254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0950  -16.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 10 15  1  0
 16 17  1  0
 17 20  1  0
 19 18  1  0
 18 16  2  0
  4 16  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 13 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 31  1  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474912

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II alpha (6317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW-620 (52400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1689AlogP: 4.01#Rotatable Bonds: 5
Polar Surface Area: 87.83Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.06CX Basic pKa: 6.91CX LogP: 2.39CX LogD: 2.48
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.90

References

1. Abraham AD, Esquer H, Zhou Q, Tomlinson N, Hamill BD, Abbott JM, Li L, Pike LA, Rinaldetti S, Ramirez DA, Lunghofer PJ, Gomez JD, Schaack J, Nemkov T, D'Alessandro A, Hansen KC, Gustafson DL, Messersmith WA, LaBarbera DV..  (2019)  Drug Design Targeting T-Cell Factor-Driven Epithelial-Mesenchymal Transition as a Therapeutic Strategy for Colorectal Cancer.,  62  (22): [PMID:31675229] [10.1021/acs.jmedchem.9b01065]

Source