The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-(3R,5S)-5-((2-((3-(2,4-bis(trifluoromethyl)phenyl)thiophen-2-yl)methylene)hydrazinyl)methyl)piperidine-3-carboxylic acid ID: ALA4474919
PubChem CID: 155537583
Max Phase: Preclinical
Molecular Formula: C20H19F6N3O2S
Molecular Weight: 479.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2sccc2-c2ccc(C(F)(F)F)cc2C(F)(F)F)C1
Standard InChI: InChI=1S/C20H19F6N3O2S/c21-19(22,23)13-1-2-14(16(6-13)20(24,25)26)15-3-4-32-17(15)10-29-28-8-11-5-12(18(30)31)9-27-7-11/h1-4,6,10-12,27-28H,5,7-9H2,(H,30,31)/b29-10+/t11-,12+/m0/s1
Standard InChI Key: GYOJLWHYYQSCMJ-ZMRCOEFLSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
31.9406 -11.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6507 -11.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3714 -11.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3833 -10.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6685 -10.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9507 -10.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6771 -9.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4223 -8.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3208 -8.0432 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.5107 -7.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1116 -8.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1448 -9.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2409 -10.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2501 -9.1969 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.5219 -10.4263 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.5249 -9.6041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6383 -12.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9178 -12.9166 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.3465 -12.9379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6187 -13.3415 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.7935 -8.8866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5143 -9.2881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2224 -8.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9431 -9.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9511 -10.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6676 -10.4924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3782 -10.0725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3676 -9.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6463 -8.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0771 -8.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7964 -9.2298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0673 -8.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
8 12 1 0
6 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
2 17 1 0
17 18 1 0
17 19 1 0
17 20 1 0
12 21 2 0
21 22 1 0
22 23 1 0
24 23 1 1
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 1
30 31 1 0
30 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.45Molecular Weight (Monoisotopic): 479.1102AlogP: 4.69#Rotatable Bonds: 6Polar Surface Area: 73.72Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.06CX Basic pKa: 10.06CX LogP: 1.99CX LogD: 1.99Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -0.95
References 1. Hauke TJ, Wein T, Höfner G, Wanner KT.. (2018) Novel Allosteric Ligands of γ-Aminobutyric Acid Transporter 1 (GAT1) by MS Based Screening of Pseudostatic Hydrazone Libraries., 61 (22): [PMID:30376325 ] [10.1021/acs.jmedchem.8b01602 ]