N-ethyl-4-(4-(3-methoxypyridin-2-yl)piperidin-1-yl)azepane-1-carboxamide

ID: ALA4474926

PubChem CID: 155537519

Max Phase: Preclinical

Molecular Formula: C20H32N4O2

Molecular Weight: 360.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCNC(=O)N1CCCC(N2CCC(c3ncccc3OC)CC2)CC1

Standard InChI:  InChI=1S/C20H32N4O2/c1-3-21-20(25)24-12-5-6-17(10-15-24)23-13-8-16(9-14-23)19-18(26-2)7-4-11-22-19/h4,7,11,16-17H,3,5-6,8-10,12-15H2,1-2H3,(H,21,25)

Standard InChI Key:  KZOVGRHHJQWGNJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   28.2426   -5.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0580   -5.0708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4649   -4.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0575   -3.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2390   -3.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8358   -4.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2832   -4.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6904   -5.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5040   -5.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9166   -4.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5094   -3.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6896   -3.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4650   -2.9519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2822   -2.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7338   -4.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0940   -3.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8929   -3.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0906   -5.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5318   -3.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8883   -5.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5275   -4.7833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2630   -5.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3223   -5.9545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9391   -4.6805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0578   -6.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1171   -7.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3  7  1  0
  4 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 17 19  1  0
 18 20  1  0
 19 21  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474926

    ---

Associated Targets(Human)

CHRM4 Tclin Muscarinic acetylcholine receptor M4 (6041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.50Molecular Weight (Monoisotopic): 360.2525AlogP: 2.85#Rotatable Bonds: 4
Polar Surface Area: 57.70Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.14CX LogP: 1.23CX LogD: -0.51
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.90Np Likeness Score: -1.34

References

1. Yang Q, Lachapelle EA, Kablaoui NM, Webb D, Popiolek M, Grimwood S, Kozak R, O'Connor RE, Lazzaro JT, Butler CR, Zhang L..  (2019)  Discovery of Selective M4 Muscarinic Acetylcholine Receptor Agonists with Novel Carbamate Isosteres.,  10  (6): [PMID:31223452] [10.1021/acsmedchemlett.9b00106]

Source