(E)-3-(2-Iodophenyl)-1-(3-phenylpyrrolo[1,2-a]pyrazin-8-yl)prop-2-en-1-one

ID: ALA4474928

PubChem CID: 155537521

Max Phase: Preclinical

Molecular Formula: C22H15IN2O

Molecular Weight: 450.28

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccccc1I)c1ccn2cc(-c3ccccc3)ncc12

Standard InChI:  InChI=1S/C22H15IN2O/c23-19-9-5-4-6-16(19)10-11-22(26)18-12-13-25-15-20(24-14-21(18)25)17-7-2-1-3-8-17/h1-15H/b11-10+

Standard InChI Key:  UIWPNFPXTAOBHW-ZHACJKMWSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    1.5711  -16.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5699  -16.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2780  -17.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9876  -16.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9848  -16.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2762  -15.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6910  -15.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3975  -16.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3936  -14.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6834  -14.7871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1027  -14.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0996  -15.6029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8758  -15.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3587  -15.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8808  -14.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1363  -13.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9503  -13.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6556  -13.0992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3623  -14.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1795  -14.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5903  -15.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4067  -15.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8126  -14.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3962  -13.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5811  -13.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1841  -15.8745    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  7 10  1  0
  8 12  1  0
 11  9  1  0
  9 10  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  2  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474928

    ---

Associated Targets(Human)

U-937 (7138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.28Molecular Weight (Monoisotopic): 450.0229AlogP: 5.50#Rotatable Bonds: 4
Polar Surface Area: 34.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.27CX LogD: 5.27
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.23Np Likeness Score: -0.85

References

1. Kim J, Park M, Choi J, Singh DK, Kwon HJ, Kim SH, Kim I..  (2019)  Design, synthesis, and biological evaluation of novel pyrrolo[1,2-a]pyrazine derivatives.,  29  (11): [PMID:30954427] [10.1016/j.bmcl.2019.03.044]

Source