N-((S)-3-(4-Fluorophenyl)-1-(((S,E)-5-(methylamino)-5-oxo-1-((S)-2-oxopiperidin-3-yl)pent-3-en-2-yl)amino)-1-oxopropan-2-yl)-5-methylisoxazole-3-carboxamide

ID: ALA4474933

PubChem CID: 155537527

Max Phase: Preclinical

Molecular Formula: C25H30FN5O5

Molecular Weight: 499.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)/C=C/[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc(C)on1

Standard InChI:  InChI=1S/C25H30FN5O5/c1-15-12-21(31-36-15)25(35)30-20(13-16-5-7-18(26)8-6-16)24(34)29-19(9-10-22(32)27-2)14-17-4-3-11-28-23(17)33/h5-10,12,17,19-20H,3-4,11,13-14H2,1-2H3,(H,27,32)(H,28,33)(H,29,34)(H,30,35)/b10-9+/t17-,19+,20-/m0/s1

Standard InChI Key:  ORHPSJWXBRXHIF-PKGCSEMASA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   31.5513   -5.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2667   -5.2931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8359   -5.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5513   -6.5293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9823   -5.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6936   -5.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4090   -5.7038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6936   -4.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9823   -6.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6936   -6.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6890   -7.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4037   -8.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1201   -7.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1175   -6.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4022   -6.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8361   -8.1803    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.1245   -5.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8399   -5.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5553   -5.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1245   -4.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8399   -4.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5533   -4.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2666   -4.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2709   -3.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5555   -2.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8360   -3.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1205   -2.8214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2709   -5.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9863   -5.2931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2709   -6.5293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7017   -5.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7498   -4.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9423   -4.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5274   -5.0148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0812   -5.6251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6041   -3.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  5  9  1  6
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 17  7  1  1
 17 18  1  0
 18 19  2  0
 17 20  1  0
 21 20  1  1
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 19 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
  3 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 35  3  2  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474933

    ---

Associated Targets(Human)

RD (1212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Enterovirus A71 (1246 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.54Molecular Weight (Monoisotopic): 499.2231AlogP: 1.17#Rotatable Bonds: 10
Polar Surface Area: 142.43Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.46CX Basic pKa: CX LogP: 0.83CX LogD: 0.83
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -0.52

References

1. Ma Y, Li L, He S, Shang C, Sun Y, Liu N, Meek TD, Wang Y, Shang L..  (2019)  Application of Dually Activated Michael Acceptor to the Rational Design of Reversible Covalent Inhibitor for Enterovirus 71 3C Protease.,  62  (13): [PMID:31184893] [10.1021/acs.jmedchem.9b00387]

Source