9-(3-(2-Methoxyphenoxy)propyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole 2,2,2-trifluoroacetate

ID: ALA4474956

PubChem CID: 155537612

Max Phase: Preclinical

Molecular Formula: C23H25F3N2O4

Molecular Weight: 336.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1OCCCn1c2c(c3ccccc31)CCNC2.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C21H24N2O2.C2HF3O2/c1-24-20-9-4-5-10-21(20)25-14-6-13-23-18-8-3-2-7-16(18)17-11-12-22-15-19(17)23;3-2(4,5)1(6)7/h2-5,7-10,22H,6,11-15H2,1H3;(H,6,7)

Standard InChI Key:  VOFJEJVYAPCMMT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   27.5732  -11.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2809  -11.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9887  -11.9356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2809  -10.7098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8409  -12.3663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.7750  -11.6320    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.5478  -12.8064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.5717  -11.0213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1592  -12.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9070  -11.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1043  -11.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5531  -11.9477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8100  -12.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6121  -12.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2411  -11.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9785  -12.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5258  -12.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3385  -12.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6010  -11.9617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0509  -11.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5700  -10.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2836   -9.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2818   -8.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9955   -8.5431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7108   -8.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7083   -9.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4228  -10.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1375   -9.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1331   -8.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4180   -8.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4134   -7.7159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1255   -7.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9 16  1  0
 15  8  1  0
  8 10  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  8 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 30 31  1  0
 31 32  1  0
M  END

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.44Molecular Weight (Monoisotopic): 336.1838AlogP: 3.76#Rotatable Bonds: 6
Polar Surface Area: 35.42Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.02CX LogP: 3.36CX LogD: 1.74
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.70Np Likeness Score: -0.50

References

1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C..  (2019)  Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis.,  62  (5): [PMID:30753074] [10.1021/acs.jmedchem.8b01598]

Source