The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((Pentafluorophenyl)Thio)-4-Oxo-N-((S)-1-Phenylethyl)Azetidine-1-Carboxamide ID: ALA4474977
PubChem CID: 155537674
Max Phase: Preclinical
Molecular Formula: C18H13F5N2O2S
Molecular Weight: 416.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)N1C(=O)C[C@H]1Sc1c(F)c(F)c(F)c(F)c1F)c1ccccc1
Standard InChI: InChI=1S/C18H13F5N2O2S/c1-8(9-5-3-2-4-6-9)24-18(27)25-10(26)7-11(25)28-17-15(22)13(20)12(19)14(21)16(17)23/h2-6,8,11H,7H2,1H3,(H,24,27)/t8-,11+/m0/s1
Standard InChI Key: FXWWYLBLFPYVNL-GZMMTYOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
4.3377 -17.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3377 -17.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1590 -17.9121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1590 -17.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7557 -18.4941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7410 -16.5089 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5253 -15.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1072 -15.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8962 -14.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1020 -14.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5189 -14.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7329 -15.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8894 -13.3378 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4757 -13.7712 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8957 -15.3546 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1576 -16.0889 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7289 -14.5086 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7368 -18.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5253 -19.2793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5262 -18.2785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1032 -19.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8925 -19.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4691 -20.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2578 -20.0152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4700 -19.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8873 -18.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1008 -18.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -20.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
2 5 2 0
4 6 1 1
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
9 14 1 0
8 15 1 0
12 16 1 0
11 17 1 0
3 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.37Molecular Weight (Monoisotopic): 416.0618AlogP: 4.50#Rotatable Bonds: 4Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.39CX Basic pKa: ┄CX LogP: 4.23CX LogD: 4.23Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.35Np Likeness Score: -0.70
References 1. Kuskovsky R, Lloyd D, Arora K, Plotkin BJ, Green JM, Boshoff HI, Barry C, Deschamps J, Konaklieva MI.. (2019) C4-Phenylthio β-lactams: Effect of the chirality of the β-lactam ring on antimicrobial activity., 27 (20): [PMID:31474471 ] [10.1016/j.bmc.2019.115050 ]