The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((1-(3-((2-oxo-2H-chromen-7-yl)oxy)propyl)-1H-1,2,3-triazol-4-yl)methoxy)benzaldehyde ID: ALA4475016
PubChem CID: 155537404
Max Phase: Preclinical
Molecular Formula: C22H19N3O5
Molecular Weight: 405.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=Cc1cccc(OCc2cn(CCCOc3ccc4ccc(=O)oc4c3)nn2)c1
Standard InChI: InChI=1S/C22H19N3O5/c26-14-16-3-1-4-19(11-16)29-15-18-13-25(24-23-18)9-2-10-28-20-7-5-17-6-8-22(27)30-21(17)12-20/h1,3-8,11-14H,2,9-10,15H2
Standard InChI Key: NVNIDGYSZZAEON-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
35.9055 -23.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9043 -24.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6124 -24.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6106 -23.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3192 -23.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3180 -24.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0242 -24.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7361 -24.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7373 -23.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0266 -23.1966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1977 -23.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4460 -23.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4901 -23.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7822 -23.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0746 -23.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3668 -23.2041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2805 -22.3927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4811 -22.2230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0726 -22.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6197 -23.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2526 -22.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8440 -22.2232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0268 -22.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6211 -21.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8047 -21.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3953 -22.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8083 -22.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6234 -22.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4022 -23.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5850 -23.6450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
1 11 1 0
9 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.41Molecular Weight (Monoisotopic): 405.1325AlogP: 3.25#Rotatable Bonds: 9Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.90CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.24Np Likeness Score: -0.92
References 1. Zengin Kurt B, Sonmez F, Ozturk D, Akdemir A, Angeli A, Supuran CT.. (2019) Synthesis of coumarin-sulfonamide derivatives and determination of their cytotoxicity, carbonic anhydrase inhibitory and molecular docking studies., 183 [PMID:31542715 ] [10.1016/j.ejmech.2019.111702 ]