3-alpha-tigloylmelianol

ID: ALA4475021

PubChem CID: 155537407

Max Phase: Preclinical

Molecular Formula: C35H54O5

Molecular Weight: 554.81

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C(\C)C(=O)O[C@@H]1CC[C@]2(C)[C@H]3CC[C@@]4(C)[C@@H]([C@@H]5C[C@H]([C@@H]6OC6(C)C)O[C@H]5O)CC[C@]4(C)C3=CC[C@H]2C1(C)C

Standard InChI:  InChI=1S/C35H54O5/c1-10-20(2)29(36)39-27-15-16-33(7)23-14-18-34(8)22(21-19-25(38-30(21)37)28-32(5,6)40-28)13-17-35(34,9)24(23)11-12-26(33)31(27,3)4/h10-11,21-23,25-28,30,37H,12-19H2,1-9H3/b20-10+/t21-,22+,23-,25+,26-,27+,28-,30+,33+,34-,35+/m0/s1

Standard InChI Key:  DSOLXMHDQJAGIK-VZKXGLGDSA-N

Molfile:  

 
     RDKit          2D

 46 51  0  0  0  0  0  0  0  0999 V2000
   39.5595  -15.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1550  -15.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7460  -15.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4534  -13.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4534  -14.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1587  -13.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8639  -13.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8605  -14.6351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5625  -15.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2726  -14.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5695  -13.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2722  -13.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2889  -12.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5748  -12.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9916  -12.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9828  -13.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7540  -13.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2395  -13.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7683  -12.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8566  -13.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9780  -14.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0292  -11.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8056  -11.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8145  -10.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0400  -10.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.5526  -10.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7355  -10.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2645   -9.2615    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   45.2994  -11.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4800  -10.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2220  -10.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1448   -9.5843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.9278   -9.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7458  -15.0440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0380  -14.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3304  -15.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0377  -13.8184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6226  -14.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3307  -15.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6231  -16.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7321  -12.0020    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.1968  -11.7851    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.4085  -13.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5624  -14.2266    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.6941   -9.7248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.8525  -15.4482    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  2  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
  7 20  1  1
 16 21  1  1
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 26 27  1  6
 24 30  1  0
 30 28  1  1
 31 29  1  0
 31 30  1  0
 32 31  1  0
 30 32  1  0
 31 33  1  0
  5 34  1  6
 34 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 36 39  2  0
 39 40  1  0
 22 41  1  6
 19 42  1  6
 15 43  1  6
 11 44  1  6
 24 45  1  6
  8 46  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4475021

    ---

Associated Targets(non-human)

dengue virus type 2 (2400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.81Molecular Weight (Monoisotopic): 554.3971AlogP: 7.37#Rotatable Bonds: 4
Polar Surface Area: 68.29Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.17CX Basic pKa: CX LogP: 7.23CX LogD: 7.23
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: 3.55

References

1. Dighe SN, Ekwudu O, Dua K, Chellappan DK, Katavic PL, Collet TA..  (2019)  Recent update on anti-dengue drug discovery.,  176  [PMID:31128447] [10.1016/j.ejmech.2019.05.010]

Source