The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-[4-(Ethylsulfonyl)phenyl]-2-{[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]amino}-2-oxoethyl)-3-phenylpropanamide ID: ALA4475033
PubChem CID: 155537626
Max Phase: Preclinical
Molecular Formula: C28H26F6N2O5S
Molecular Weight: 616.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(C(NC(=O)CCc2ccccc2)C(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1
Standard InChI: InChI=1S/C28H26F6N2O5S/c1-2-42(40,41)22-15-9-19(10-16-22)24(36-23(37)17-8-18-6-4-3-5-7-18)25(38)35-21-13-11-20(12-14-21)26(39,27(29,30)31)28(32,33)34/h3-7,9-16,24,39H,2,8,17H2,1H3,(H,35,38)(H,36,37)
Standard InChI Key: PQFJZLIBNHRYQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
21.8503 -17.1749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2694 -17.8926 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.6799 -17.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2773 -19.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9881 -19.5479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7031 -19.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4190 -19.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7022 -18.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1300 -19.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8434 -19.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5579 -19.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5574 -18.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8364 -17.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1248 -18.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9885 -18.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7029 -17.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2779 -18.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5681 -17.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8574 -18.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8610 -19.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5713 -19.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1409 -17.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1389 -17.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4264 -18.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4203 -17.4986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7140 -17.9164 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4284 -19.1551 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7109 -18.7348 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8534 -16.6749 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4224 -16.6784 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.1338 -16.2581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4199 -20.3718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1318 -20.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1327 -21.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8469 -20.3703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8487 -22.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8496 -22.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1335 -23.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1341 -24.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8506 -24.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5680 -24.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5640 -23.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 2 1 0
2 15 1 0
15 16 1 0
4 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 4 1 0
19 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
24 26 1 0
24 27 1 0
24 28 1 0
23 29 1 0
23 30 1 0
23 31 1 0
7 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.58Molecular Weight (Monoisotopic): 616.1467AlogP: 5.22#Rotatable Bonds: 10Polar Surface Area: 112.57Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.41CX Basic pKa: ┄CX LogP: 4.80CX LogD: 4.50Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -1.15
References 1. von Berg S, Xue Y, Collins M, Llinas A, Olsson RI, Halvarsson T, Lindskog M, Malmberg J, Jirholt J, Krutrök N, Ramnegård M, Brännström M, Lundqvist A, Lepistö M, Aagaard A, McPheat J, Hansson EL, Chen R, Xiong Y, Hansson TG, Narjes F.. (2019) Discovery of Potent and Orally Bioavailable Inverse Agonists of the Retinoic Acid Receptor-Related Orphan Receptor C2., 10 (6): [PMID:31223457 ] [10.1021/acsmedchemlett.9b00158 ]