The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,4R,5R)-2-(Hydroxymethyl)-5-(6-(4-(4-(6-methoxypyridin-3-yl)phenyl)piperazin-1-yl)-9H-purin-9-yl)tetrahydrofuran-3,4-diol ID: ALA4475059
PubChem CID: 155537423
Max Phase: Preclinical
Molecular Formula: C26H29N7O5
Molecular Weight: 519.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(N3CCN(c4ncnc5c4ncn5[C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)CC3)cc2)cn1
Standard InChI: InChI=1S/C26H29N7O5/c1-37-20-7-4-17(12-27-20)16-2-5-18(6-3-16)31-8-10-32(11-9-31)24-21-25(29-14-28-24)33(15-30-21)26-23(36)22(35)19(13-34)38-26/h2-7,12,14-15,19,22-23,26,34-36H,8-11,13H2,1H3/t19-,22-,23-,26-/m1/s1
Standard InChI Key: KPLOKPNBAAPEML-VJUOEERUSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
24.4157 -11.3334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4262 -10.0100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9433 -10.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2036 -10.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1904 -11.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8915 -11.5117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6103 -11.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6235 -10.2929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9179 -9.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9300 -9.0512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6506 -8.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6645 -7.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9647 -7.4186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2493 -7.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2336 -8.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1529 -12.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3730 -12.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3637 -13.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1381 -13.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6257 -12.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4429 -12.7868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3818 -14.2133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6972 -13.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9545 -13.3040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9781 -6.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6949 -6.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7103 -5.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0098 -4.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2922 -5.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2803 -6.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0250 -4.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7412 -3.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7555 -2.9430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0544 -2.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3374 -2.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3265 -3.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0674 -1.7044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7814 -1.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 2 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
16 1 1 1
20 21 1 6
19 22 1 6
18 23 1 1
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
13 25 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 31 1 0
34 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.56Molecular Weight (Monoisotopic): 519.2230AlogP: 0.84#Rotatable Bonds: 6Polar Surface Area: 142.12Molecular Species: NEUTRALHBA: 12HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.45CX Basic pKa: 4.53CX LogP: 1.45CX LogD: 1.45Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -0.32
References 1. Crespo RA, Dang Q, Zhou NE, Guthrie LM, Snavely TC, Dong W, Loesch KA, Suzuki T, You L, Wang W, O'Malley T, Parish T, Olsen DB, Sacchettini JC.. (2019) Structure-Guided Drug Design of 6-Substituted Adenosine Analogues as Potent Inhibitors of Mycobacterium tuberculosis Adenosine Kinase., 62 (9): [PMID:31002508 ] [10.1021/acs.jmedchem.9b00020 ]