4-Fluoro-N-((S)-1-oxo-1-(((S,E)-6-oxo-1-phenylhept-4-en-3-yl)-amino)-3-phenylpropan-2-yl)benzamide

ID: ALA4475066

PubChem CID: 155537428

Max Phase: Preclinical

Molecular Formula: C29H29FN2O3

Molecular Weight: 472.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(F)cc1

Standard InChI:  InChI=1S/C29H29FN2O3/c1-21(33)12-18-26(19-13-22-8-4-2-5-9-22)31-29(35)27(20-23-10-6-3-7-11-23)32-28(34)24-14-16-25(30)17-15-24/h2-12,14-18,26-27H,13,19-20H2,1H3,(H,31,35)(H,32,34)/b18-12+/t26-,27+/m1/s1

Standard InChI Key:  GJMFJSMWCBYWQN-MOKQZDJKSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   10.3923  -16.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1092  -16.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1092  -15.4634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8224  -16.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6791  -16.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9659  -16.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2527  -16.2845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5353  -16.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8222  -16.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090  -16.6993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917  -16.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917  -15.4632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6785  -16.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6782  -17.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9675  -17.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2541  -17.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2518  -16.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9651  -16.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5368  -17.9324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8222  -15.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5353  -15.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5358  -14.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2506  -13.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9640  -14.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9663  -15.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2530  -15.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5353  -17.5246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9659  -17.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6791  -17.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6791  -18.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3922  -19.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3911  -19.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6776  -20.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9683  -19.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9616  -19.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  1  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
  9 20  1  1
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
  8 27  2  0
  6 28  1  6
 28 29  1  0
 29 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4475066

    ---

Associated Targets(Human)

CTSL Tclin Cathepsin L (3852 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

rhodesain Rhodesain (1463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trypanosoma brucei brucei (13300 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.56Molecular Weight (Monoisotopic): 472.2162AlogP: 4.43#Rotatable Bonds: 11
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.13

References

1. Ettari R, Previti S, Maiorana S, Amendola G, Wagner A, Cosconati S, Schirmeister T, Hellmich UA, Zappalà M..  (2019)  Optimization Strategy of Novel Peptide-Based Michael Acceptors for the Treatment of Human African Trypanosomiasis.,  62  (23): [PMID:31714776] [10.1021/acs.jmedchem.9b00908]

Source