The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-Amino-N-(4-((1-amino-1-oxopropan-2-yl)carbamoyl)benzyl)-1-phenyl-1H-pyrazole-4-carboxamide ID: ALA4475072
PubChem CID: 155537433
Max Phase: Preclinical
Molecular Formula: C21H22N6O3
Molecular Weight: 406.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)c1ccc(CNC(=O)c2cnn(-c3ccccc3)c2N)cc1)C(N)=O
Standard InChI: InChI=1S/C21H22N6O3/c1-13(19(23)28)26-20(29)15-9-7-14(8-10-15)11-24-21(30)17-12-25-27(18(17)22)16-5-3-2-4-6-16/h2-10,12-13H,11,22H2,1H3,(H2,23,28)(H,24,30)(H,26,29)/t13-/m0/s1
Standard InChI Key: UBEIVLMQHPFNMW-ZDUSSCGKSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
6.6039 -9.9767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8860 -9.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1682 -9.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8858 -8.7366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4100 -9.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8545 -10.2548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2709 -10.9726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0811 -10.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0258 -10.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6222 -9.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7943 -9.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3702 -10.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7842 -10.9536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 -10.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3165 -9.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0313 -9.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0280 -10.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7420 -11.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4556 -10.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4506 -9.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7360 -9.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1709 -11.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1743 -12.0266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8829 -10.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2387 -8.8362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5983 -11.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3102 -10.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0256 -11.1908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3069 -9.9576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6016 -12.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 2 0
22 24 1 0
5 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
26 30 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.45Molecular Weight (Monoisotopic): 406.1753AlogP: 0.99#Rotatable Bonds: 7Polar Surface Area: 145.13Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.57CX Basic pKa: 2.08CX LogP: 1.08CX LogD: 1.08Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.63
References 1. Röhm S, Berger BT, Schröder M, Chaikuad A, Winkel R, Hekking KFW, Benningshof JJC, Müller G, Tesch R, Kudolo M, Forster M, Laufer S, Knapp S.. (2019) Fast Iterative Synthetic Approach toward Identification of Novel Highly Selective p38 MAP Kinase Inhibitors., 62 (23): [PMID:31702918 ] [10.1021/acs.jmedchem.9b01227 ]