(S)-5-Amino-N-(4-((1-amino-1-oxopropan-2-yl)carbamoyl)benzyl)-1-phenyl-1H-pyrazole-4-carboxamide

ID: ALA4475072

PubChem CID: 155537433

Max Phase: Preclinical

Molecular Formula: C21H22N6O3

Molecular Weight: 406.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)c1ccc(CNC(=O)c2cnn(-c3ccccc3)c2N)cc1)C(N)=O

Standard InChI:  InChI=1S/C21H22N6O3/c1-13(19(23)28)26-20(29)15-9-7-14(8-10-15)11-24-21(30)17-12-25-27(18(17)22)16-5-3-2-4-6-16/h2-10,12-13H,11,22H2,1H3,(H2,23,28)(H,24,30)(H,26,29)/t13-/m0/s1

Standard InChI Key:  UBEIVLMQHPFNMW-ZDUSSCGKSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    6.6039   -9.9767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8860   -9.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1682   -9.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8858   -8.7366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4100   -9.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8545  -10.2548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2709  -10.9726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0811  -10.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0258  -10.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6222   -9.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7943   -9.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3702  -10.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7842  -10.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108  -10.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3165   -9.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0313   -9.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0280  -10.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7420  -11.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4556  -10.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4506   -9.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7360   -9.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1709  -11.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1743  -12.0266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8829  -10.7875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2387   -8.8362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5983  -11.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3102  -10.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0256  -11.1908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3069   -9.9576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6016  -12.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 22 24  1  0
  5 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 26 30  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4475072

    ---

Associated Targets(Human)

MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK11 Tchem MAP kinase p38 beta (2785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.45Molecular Weight (Monoisotopic): 406.1753AlogP: 0.99#Rotatable Bonds: 7
Polar Surface Area: 145.13Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.57CX Basic pKa: 2.08CX LogP: 1.08CX LogD: 1.08
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.63

References

1. Röhm S, Berger BT, Schröder M, Chaikuad A, Winkel R, Hekking KFW, Benningshof JJC, Müller G, Tesch R, Kudolo M, Forster M, Laufer S, Knapp S..  (2019)  Fast Iterative Synthetic Approach toward Identification of Novel Highly Selective p38 MAP Kinase Inhibitors.,  62  (23): [PMID:31702918] [10.1021/acs.jmedchem.9b01227]

Source