1-(2-(4-(4-Chlorobenzyl)piperazin-1-yl)-2-oxoethyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione

ID: ALA4475078

PubChem CID: 26756455

Max Phase: Preclinical

Molecular Formula: C20H23ClN6O3

Molecular Weight: 430.90

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cnc2c1c(=O)n(CC(=O)N1CCN(Cc3ccc(Cl)cc3)CC1)c(=O)n2C

Standard InChI:  InChI=1S/C20H23ClN6O3/c1-23-13-22-18-17(23)19(29)27(20(30)24(18)2)12-16(28)26-9-7-25(8-10-26)11-14-3-5-15(21)6-4-14/h3-6,13H,7-12H2,1-2H3

Standard InChI Key:  VHGQRQGNPLMASI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.8432   -6.7067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8432   -7.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5485   -7.9284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5485   -6.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5485   -5.4768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1361   -7.9336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2538   -6.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2537   -7.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0276   -7.7719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5060   -7.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0277   -6.4554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2802   -5.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5500   -8.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1343   -6.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4278   -6.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4302   -7.5281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7189   -6.3044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7198   -5.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0150   -5.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3060   -5.4893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3065   -6.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0158   -6.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5987   -5.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5994   -4.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3061   -3.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3071   -3.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5993   -2.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8888   -3.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8913   -3.8586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5989   -1.8140    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  8  1  0
  7  4  1  0
  4  5  2  0
  2  6  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
 11 12  1  0
  3 13  1  0
  1 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
M  END

Associated Targets(Human)

MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.90Molecular Weight (Monoisotopic): 430.1520AlogP: 0.43#Rotatable Bonds: 4
Polar Surface Area: 85.37Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.02CX LogP: 0.75CX LogD: 0.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -1.77

References

1. Ma T, Ma QS, Yu B, Liu HM..  (2019)  Discovery of the theobromine derivative MQS-14 that induces death of MGC-803 cells mainly through ROS-mediated mechanisms.,  174  [PMID:31029946] [10.1016/j.ejmech.2019.04.044]

Source