The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1H-indazol-6-yl)-4-methyl-N-(3-(4-methylpiperazin-1-yl)benzyl)benzamide ID: ALA4475127
PubChem CID: 155537617
Max Phase: Preclinical
Molecular Formula: C27H29N5O
Molecular Weight: 439.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)NCc2cccc(N3CCN(C)CC3)c2)cc1-c1ccc2cn[nH]c2c1
Standard InChI: InChI=1S/C27H29N5O/c1-19-6-7-22(15-25(19)21-8-9-23-18-29-30-26(23)16-21)27(33)28-17-20-4-3-5-24(14-20)32-12-10-31(2)11-13-32/h3-9,14-16,18H,10-13,17H2,1-2H3,(H,28,33)(H,29,30)
Standard InChI Key: MCIUUQCOIUPBFO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
29.4846 -11.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1943 -10.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1915 -10.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4829 -9.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7766 -10.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7733 -10.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9914 -9.8472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5114 -10.5134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9968 -11.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8946 -9.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6042 -10.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3098 -9.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3072 -8.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5930 -8.4590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8902 -8.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1799 -8.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0189 -10.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0216 -10.9062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7252 -9.6781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4343 -10.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1348 -9.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8396 -10.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5397 -9.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5336 -8.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8216 -8.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1244 -8.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2505 -10.0666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2522 -10.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9589 -11.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6660 -10.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6618 -10.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9505 -9.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3752 -11.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
3 10 1 0
15 16 1 0
12 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
21 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
23 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.56Molecular Weight (Monoisotopic): 439.2372AlogP: 4.22#Rotatable Bonds: 5Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.93CX Basic pKa: 7.91CX LogP: 4.21CX LogD: 3.58Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.62
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]