The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(3,4-dihydro-1H-pyrido[3,4-b]indol-9(2H)-yl)propyl)-3-fluoroaniline 2,2,2-trifluoroacetate ID: ALA4475167
PubChem CID: 155537633
Max Phase: Preclinical
Molecular Formula: C22H23F4N3O2
Molecular Weight: 323.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cccc(NCCCn2c3c(c4ccccc42)CCNC3)c1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C20H22FN3.C2HF3O2/c21-15-5-3-6-16(13-15)23-10-4-12-24-19-8-2-1-7-17(19)18-9-11-22-14-20(18)24;3-2(4,5)1(6)7/h1-3,5-8,13,22-23H,4,9-12,14H2;(H,6,7)
Standard InChI Key: JONYCILTKCAIGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
10.2903 -6.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9980 -6.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7057 -6.5141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9980 -5.2883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6464 -6.8859 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4921 -6.2106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2944 -7.4439 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6207 -5.4333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2082 -6.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9560 -5.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1534 -5.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6021 -6.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8591 -7.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6612 -7.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2901 -5.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0275 -6.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5747 -7.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3874 -7.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6499 -6.3736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0998 -5.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6189 -4.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3326 -4.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3307 -3.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0444 -2.9552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7596 -3.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7572 -4.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4717 -4.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1863 -4.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1819 -3.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4668 -2.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8940 -2.9437 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 16 1 0
15 8 1 0
8 10 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
29 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 323.42Molecular Weight (Monoisotopic): 323.1798AlogP: 3.93#Rotatable Bonds: 5Polar Surface Area: 28.99Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.02CX LogP: 3.29CX LogD: 1.67Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.70Np Likeness Score: -1.20
References 1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C.. (2019) Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis., 62 (5): [PMID:30753074 ] [10.1021/acs.jmedchem.8b01598 ]