N-(3-(3,4-dihydro-1H-pyrido[3,4-b]indol-9(2H)-yl)propyl)-3-fluoroaniline 2,2,2-trifluoroacetate

ID: ALA4475167

PubChem CID: 155537633

Max Phase: Preclinical

Molecular Formula: C22H23F4N3O2

Molecular Weight: 323.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1cccc(NCCCn2c3c(c4ccccc42)CCNC3)c1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C20H22FN3.C2HF3O2/c21-15-5-3-6-16(13-15)23-10-4-12-24-19-8-2-1-7-17(19)18-9-11-22-14-20(18)24;3-2(4,5)1(6)7/h1-3,5-8,13,22-23H,4,9-12,14H2;(H,6,7)

Standard InChI Key:  JONYCILTKCAIGD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   10.2903   -6.5141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9980   -6.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7057   -6.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9980   -5.2883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6464   -6.8859    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4921   -6.2106    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2944   -7.4439    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.6207   -5.4333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2082   -6.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9560   -5.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1534   -5.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6021   -6.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8591   -7.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6612   -7.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2901   -5.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0275   -6.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5747   -7.3244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3874   -7.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6499   -6.3736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0998   -5.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6189   -4.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3326   -4.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3307   -3.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0444   -2.9552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7596   -3.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7572   -4.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4717   -4.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1863   -4.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1819   -3.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4668   -2.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8940   -2.9437    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9 16  1  0
 15  8  1  0
  8 10  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  8 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
M  END

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.42Molecular Weight (Monoisotopic): 323.1798AlogP: 3.93#Rotatable Bonds: 5
Polar Surface Area: 28.99Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.02CX LogP: 3.29CX LogD: 1.67
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.70Np Likeness Score: -1.20

References

1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C..  (2019)  Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis.,  62  (5): [PMID:30753074] [10.1021/acs.jmedchem.8b01598]

Source