1-((S)-3-(7-methoxy-2-methyl-4-((R)-1-m-tolylethylamino)quinazolin-6-yloxy)pyrrolidin-1-yl)ethanone

ID: ALA4475185

PubChem CID: 153283551

Max Phase: Preclinical

Molecular Formula: C25H30N4O3

Molecular Weight: 434.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2nc(C)nc(N[C@H](C)c3cccc(C)c3)c2cc1O[C@H]1CCN(C(C)=O)C1

Standard InChI:  InChI=1S/C25H30N4O3/c1-15-7-6-8-19(11-15)16(2)26-25-21-12-24(32-20-9-10-29(14-20)18(4)30)23(31-5)13-22(21)27-17(3)28-25/h6-8,11-13,16,20H,9-10,14H2,1-5H3,(H,26,27,28)/t16-,20+/m1/s1

Standard InChI Key:  HLMVRXZLQMUHAI-UZLBHIALSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    8.4388   -3.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4376   -4.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1457   -4.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8553   -4.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8525   -3.6861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1439   -3.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1455   -5.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4377   -6.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8531   -6.1442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8529   -6.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1446   -7.3655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1441   -8.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8522   -8.5915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4361   -8.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5595   -7.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5590   -8.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2633   -8.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9684   -8.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9649   -7.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2601   -6.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6707   -6.9469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6669   -6.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6772   -8.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6792   -9.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3248   -5.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0687   -4.8699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2515   -4.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0027   -5.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7310   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5460   -4.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3591   -4.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2101   -3.4616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  6
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 16  1  0
 15 10  1  0
 12 14  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
 19 21  1  0
 22 21  1  1
 18 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 22  1  0
  1 29  1  0
 26 30  1  0
 30 31  1  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4475185

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2318AlogP: 4.43#Rotatable Bonds: 6
Polar Surface Area: 76.58Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.40CX LogP: 3.64CX LogD: 3.60
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.20

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source