The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(4-((1-(4-bromobenzyl)-1H-1,2,3-triazol-4-yl)methoxy)benzylidene)thiazolidine-2,4-dione ID: ALA4475190
PubChem CID: 155537482
Max Phase: Preclinical
Molecular Formula: C20H15BrN4O3S
Molecular Weight: 471.34
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2ccc(OCc3cn(Cc4ccc(Br)cc4)nn3)cc2)S1
Standard InChI: InChI=1S/C20H15BrN4O3S/c21-15-5-1-14(2-6-15)10-25-11-16(23-24-25)12-28-17-7-3-13(4-8-17)9-18-19(26)22-20(27)29-18/h1-9,11H,10,12H2,(H,22,26,27)/b18-9-
Standard InChI Key: UOCHXCVPYZVORD-NVMNQCDNSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
23.0051 -11.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0010 -12.0519 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.7769 -12.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2607 -11.6496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7836 -10.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1766 -11.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1755 -12.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8835 -12.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5932 -12.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5903 -11.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8817 -10.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2965 -10.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0255 -13.0868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0400 -10.2102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4674 -12.4701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7600 -12.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0442 -13.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0559 -12.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2825 -12.2049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7928 -12.8591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2632 -13.5275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8545 -14.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0373 -14.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6304 -13.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8139 -13.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4045 -14.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8174 -14.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6325 -14.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5873 -14.2355 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
10 12 1 0
12 1 2 0
3 13 2 0
5 14 2 0
7 15 1 0
15 16 1 0
16 18 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.34Molecular Weight (Monoisotopic): 470.0048AlogP: 3.99#Rotatable Bonds: 6Polar Surface Area: 86.11Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 4.04CX LogD: 2.89Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.80
References 1. Elzahhar PA, Alaaeddine R, Ibrahim TM, Nassra R, Ismail A, Chua BSK, Frkic RL, Bruning JB, Wallner N, Knape T, von Knethen A, Labib H, El-Yazbi AF, Belal ASF.. (2019) Shooting three inflammatory targets with a single bullet: Novel multi-targeting anti-inflammatory glitazones., 167 [PMID:30818268 ] [10.1016/j.ejmech.2019.02.034 ]