The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 2-(3-(1,2,3-thiadiazole-5-carboxamido)phenyl)-4-((4-(4-methylpiperazin-1-yl)phenyl)amino)thiazole-5-carboxylate ID: ALA4475234
PubChem CID: 155537331
Max Phase: Preclinical
Molecular Formula: C26H27N7O3S2
Molecular Weight: 549.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1sc(-c2cccc(NC(=O)c3csnn3)c2)nc1Nc1ccc(N2CCN(C)CC2)cc1
Standard InChI: InChI=1S/C26H27N7O3S2/c1-3-36-26(35)22-23(27-18-7-9-20(10-8-18)33-13-11-32(2)12-14-33)29-25(38-22)17-5-4-6-19(15-17)28-24(34)21-16-37-31-30-21/h4-10,15-16,27H,3,11-14H2,1-2H3,(H,28,34)
Standard InChI Key: YTENFKLGMIPETK-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
20.5839 -19.7881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4090 -19.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6657 -19.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9964 -18.5172 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.3313 -19.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8930 -20.4561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7136 -20.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1937 -21.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0136 -20.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3508 -20.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8619 -19.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0438 -19.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1675 -20.1157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6515 -20.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4686 -20.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8081 -19.9486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3241 -19.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5006 -19.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6289 -19.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5488 -18.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3780 -17.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5941 -17.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9803 -18.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1557 -19.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9394 -19.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4226 -16.8820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6380 -16.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4664 -15.8200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0248 -17.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4541 -18.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0665 -19.3010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6268 -17.9414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2218 -17.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8092 -17.7221 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.3613 -18.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1149 -17.9996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4118 -17.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5844 -16.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
2 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
10 13 1 0
16 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
5 20 1 0
22 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
30 31 2 0
30 32 1 0
3 30 1 0
29 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 29 1 0
32 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.68Molecular Weight (Monoisotopic): 549.1617AlogP: 4.59#Rotatable Bonds: 8Polar Surface Area: 112.58Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.89CX Basic pKa: 7.97CX LogP: 6.51CX LogD: 5.83Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -2.16
References 1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y.. (2019) Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines., 178 [PMID:31234030 ] [10.1016/j.ejmech.2019.06.035 ]